Difference between revisions of "CPD-12852"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ASPDECARBOX-RXN ASPDECARBOX-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.ex...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == * smiles: ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CC...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34)))) |
− | * | + | * common name: |
− | ** | + | ** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol |
+ | * inchi key: | ||
+ | ** InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N | ||
+ | * molecular weight: | ||
+ | ** 412.698 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5α-cholesta-8,24-dien-3β-ol | ||
+ | ** 4α,14α-dimethylzymosterol | ||
+ | ** 29-norlanosterol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-11881]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15101557 15101557] |
− | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}} | |
− | + | {{#set: common name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol}} | |
− | + | {{#set: inchi key=InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N}} | |
− | + | {{#set: molecular weight=412.698 }} | |
− | + | {{#set: common name=5α-cholesta-8,24-dien-3β-ol|4α,14α-dimethylzymosterol|29-norlanosterol}} | |
− | + | {{#set: consumed by=RXN-11881}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:17, 21 March 2018
Contents
Metabolite CPD-12852
- smiles:
- CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
- common name:
- 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol
- inchi key:
- InChIKey=KLZWTHGLLDRKHD-PMIIOQGLSA-N
- molecular weight:
- 412.698
- Synonym(s):
- 5α-cholesta-8,24-dien-3β-ol
- 4α,14α-dimethylzymosterol
- 29-norlanosterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(C)=CCCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.