Difference between revisions of "CPD-8653"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=Forthi Forthi] == * direction: ** LEFT-TO-RIGHT * common name: ** formate transport out via proton...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=Forthi Forthi] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
 
* common name:
 
* common name:
−
** formate transport out via proton symport, chloroplast
+
** betanidin
 +
* inchi key:
 +
** InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L
 +
* molecular weight:
 +
** 386.317   
 
* Synonym(s):
 
* Synonym(s):
 +
** betanidin radical
 +
** 2,6-Pyridinedicarboxylic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-8635]]
−
** 1.0 [[FORMATE]][h] '''+''' 1.0 [[PROTON]][h] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[FORMATE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 formate[h] '''+''' 1.0 H+[h] '''=>''' 1.0 H+[c] '''+''' 1.0 formate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13706]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* DRUGBANK : DB00217
−
{{#set: common name=formate transport out via proton symport, chloroplast}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_13706}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245506 25245506]
−
{{#set: in pathway=}}
+
* HMDB : HMDB29407
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3079 3079]
−
{{#set: reconstruction source=creinhardtii}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C08539 C08539]
 +
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
 +
{{#set: common name=betanidin}}
 +
{{#set: inchi key=InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L}}
 +
{{#set: molecular weight=386.317    }}
 +
{{#set: common name=betanidin radical|2,6-Pyridinedicarboxylic acid}}
 +
{{#set: consumed by=RXN-8635}}

Latest revision as of 20:17, 21 March 2018

Metabolite CPD-8653

  • smiles:
    • C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
  • common name:
    • betanidin
  • inchi key:
    • InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L
  • molecular weight:
    • 386.317
  • Synonym(s):
    • betanidin radical
    • 2,6-Pyridinedicarboxylic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-8653&oldid=47469"