Difference between revisions of "CPD-11673"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=H2Otf H2Otf] == * direction: ** REVERSIBLE * common name: ** H2O periplasm transport * Synonym(s):...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] == * smiles: ** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) *...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) |
* common name: | * common name: | ||
| − | ** | + | ** 5-hydroxytryptophol glucuronide |
| + | * inchi key: | ||
| + | ** InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N | ||
| + | * molecular weight: | ||
| + | ** 353.328 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10784]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173086 46173086] | |
| − | {{#set: | + | {{#set: smiles=C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))}} |
| − | {{#set: | + | {{#set: common name=5-hydroxytryptophol glucuronide}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=353.328 }} |
| − | {{#set: | + | {{#set: produced by=RXN-10784}} |
Latest revision as of 20:17, 21 March 2018
Contents
Metabolite CPD-11673
- smiles:
- C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3))
- common name:
- 5-hydroxytryptophol glucuronide
- inchi key:
- InChIKey=NFLHLWRXDOXSCF-UHFFFAOYSA-N
- molecular weight:
- 353.328
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
