Difference between revisions of "Tiso gene 8397"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-302 CPD-302] == * smiles: ** C(C(=O)[O-])C([N+])C(=O)[O-] * inchi key: ** InChIKey=CKLJMWTZ...") |
(Created page with "Category:Gene == Gene Tiso_gene_8397 == * right end position: ** 424 * transcription direction: ** POSITIVE * left end position: ** 1 * centisome position: ** 9.714396600e...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8397 == |
− | * | + | * right end position: |
− | ** | + | ** 424 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 1 |
− | * | + | * centisome position: |
− | ** | + | ** 9.714396600e-3 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RNA-LIGASE-ATP-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-17925]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-17926]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-17927]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=424}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=1}} | |
− | + | {{#set: centisome position=9.714396600e-3}} | |
− | + | {{#set: reaction associated=RNA-LIGASE-ATP-RXN|RXN-17925|RXN-17926|RXN-17927}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:17, 21 March 2018
Gene Tiso_gene_8397
- right end position:
- 424
- transcription direction:
- POSITIVE
- left end position:
- 1
- centisome position:
- 9.714396600e-3
- Synonym(s):
Reactions associated
- Reaction: RNA-LIGASE-ATP-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-17925
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-17926
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-17927
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation