Difference between revisions of "CPD-13935"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8636 == * left end position: ** 4847 * transcription direction: ** POSITIVE * right end position: ** 10042 * centisome position: ** 48.2576...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13935 CPD-13935] == * smiles: ** C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2) * common...") |
||
| (4 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13935 CPD-13935] == |
| − | * | + | * smiles: |
| − | ** | + | ** C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2) |
| − | * | + | * common name: |
| − | ** | + | ** α1,6-D mannobiose |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=DLRVVLDZNNYCBX-ONPLHCRPSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 342.299 |
* Synonym(s): | * Synonym(s): | ||
| + | ** α-D-mannosyl-(1->6)-D-mannose | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[3.2.1.152-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01728 C01728] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.388648.html 388648] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62357 62357] |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439557 439557] | ||
| + | {{#set: smiles=C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2)}} | ||
| + | {{#set: common name=α1,6-D mannobiose}} | ||
| + | {{#set: inchi key=InChIKey=DLRVVLDZNNYCBX-ONPLHCRPSA-N}} | ||
| + | {{#set: molecular weight=342.299 }} | ||
| + | {{#set: common name=α-D-mannosyl-(1->6)-D-mannose}} | ||
| + | {{#set: produced by=3.2.1.152-RXN}} | ||
Latest revision as of 19:21, 21 March 2018
Contents
Metabolite CPD-13935
- smiles:
- C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2)
- common name:
- α1,6-D mannobiose
- inchi key:
- InChIKey=DLRVVLDZNNYCBX-ONPLHCRPSA-N
- molecular weight:
- 342.299
- Synonym(s):
- α-D-mannosyl-(1->6)-D-mannose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"α-D-mannosyl-(1->6)-D-mannose" cannot be used as a page name in this wiki.
