Difference between revisions of "ACETYL-P"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALKAPHOSPHA-RXN ALKAPHOSPHA-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** alkaline_phosph...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-P ACETYL-P] == * smiles: ** CC(OP([O-])(=O)[O-])=O * common name: ** acetyl phosphate *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-P ACETYL-P] == |
− | * | + | * smiles: |
− | ** | + | ** CC(OP([O-])(=O)[O-])=O |
* common name: | * common name: | ||
− | ** | + | ** acetyl phosphate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=LIPOUNRJVLNBCD-UHFFFAOYSA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 138.016 |
* Synonym(s): | * Synonym(s): | ||
+ | ** acetyl-P | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[APhi]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * UM-BBD-CPD : c0049 |
− | * | + | * CAS : 19926-71-7 |
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4183249 4183249] |
− | + | * HMDB : HMDB01494 | |
− | + | * LIGAND-CPD: | |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00227 C00227] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.3394205.html 3394205] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=22191 22191] |
− | + | * BIGG : actp | |
− | * | + | {{#set: smiles=CC(OP([O-])(=O)[O-])=O}} |
− | ** [http://www. | + | {{#set: common name=acetyl phosphate}} |
− | + | {{#set: inchi key=InChIKey=LIPOUNRJVLNBCD-UHFFFAOYSA-L}} | |
− | + | {{#set: molecular weight=138.016 }} | |
− | * | + | {{#set: common name=acetyl-P}} |
− | + | {{#set: consumed by=APhi}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:18, 21 March 2018
Contents
Metabolite ACETYL-P
- smiles:
- CC(OP([O-])(=O)[O-])=O
- common name:
- acetyl phosphate
- inchi key:
- InChIKey=LIPOUNRJVLNBCD-UHFFFAOYSA-L
- molecular weight:
- 138.016
- Synonym(s):
- acetyl-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- UM-BBD-CPD : c0049
- CAS : 19926-71-7
- PUBCHEM:
- HMDB : HMDB01494
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : actp
"CC(OP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.