Difference between revisions of "CPD-5881"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17926 RXN-17926] == * direction: ** LEFT-TO-RIGHT * common name: ** gtp-binding_protein * Synon...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * common name:...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17926 RXN-17926] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))
 
* common name:
 
* common name:
−
** gtp-binding_protein
+
** 4α-hydroxy-tetrahydrobiopterin
 +
* inchi key:
 +
** InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N
 +
* molecular weight:
 +
** 257.249   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4α-hydroxy-5,6,7,8-tetrahydrobiopterin
 +
** 4α-hydroxy-tetrahydropterin
 +
** 6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7908]]
−
** 2 [[PROTON]][c] '''+''' 1 [[RNA-Ligase-L-lysine-adenylate]][c] '''+''' 1 [[5-Phospho-RNA]][c] '''=>''' 1 [[RNA-Ligase-L-lysine]][c] '''+''' 1 [[A-5-prime-PP-5-prime-RNA]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 H+[c] '''+''' 1 a [DNA ligase]-N6-(5'-adenylyl)-L-lysine[c] '''+''' 1 a 5'-phospho-ribonucleoside-[RNA][c] '''=>''' 1 an [RNA ligase]-L-lysine[c] '''+''' 1 a 5'-(5'-diphosphoadenosine)-(ribonucleoside)-[RNA][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_8397]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_8398]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_8396]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=gtp-binding_protein}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657593 90657593]
−
{{#set: gene associated=Tiso_gene_8397|Tiso_gene_8398|Tiso_gene_8396}}
+
* HMDB : HMDB02281
−
{{#set: in pathway=}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15374 15374]
−
{{#set: reconstruction tool=pathwaytools}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=in-silico_annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15522 C15522]
 +
{{#set: smiles=CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))}}
 +
{{#set: common name=4α-hydroxy-tetrahydrobiopterin}}
 +
{{#set: inchi key=InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N}}
 +
{{#set: molecular weight=257.249    }}
 +
{{#set: common name=4α-hydroxy-5,6,7,8-tetrahydrobiopterin|4α-hydroxy-tetrahydropterin|6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin}}
 +
{{#set: consumed by=RXN-7908}}

Latest revision as of 21:18, 21 March 2018

Metabolite CPD-5881

  • smiles:
    • CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))
  • common name:
    • 4α-hydroxy-tetrahydrobiopterin
  • inchi key:
    • InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N
  • molecular weight:
    • 257.249
  • Synonym(s):
    • 4α-hydroxy-5,6,7,8-tetrahydrobiopterin
    • 4α-hydroxy-tetrahydropterin
    • 6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-5881&oldid=47620"