Difference between revisions of "CPD-9460"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-3 RXN66-3] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.2....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9460 CPD-9460] == * smiles: ** CC6(CCC5(CCC1(C(=CC[CH]2(C1(CC[CH]3(C2(CCC(C3(C)C)OC4(C(C(C(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9460 CPD-9460] == |
− | * | + | * smiles: |
− | ** | + | ** CC6(CCC5(CCC1(C(=CC[CH]2(C1(CC[CH]3(C2(CCC(C3(C)C)OC4(C(C(C(C(O4)C(=O)[O-])O)O)O))C))C))[CH]5C6)C)C(=O)[O-])C |
− | * | + | * common name: |
− | ** | + | ** oleanolate 3 β-D-glucuronoside |
+ | * inchi key: | ||
+ | ** InChIKey=IUCHKMAZAWJNBJ-RCYXVVTDSA-L | ||
+ | * molecular weight: | ||
+ | ** 630.817 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** oleanolic acid 3 β-D-glucuronoside | ||
+ | ** oleanoic acid 3-O-glucuronide | ||
+ | ** monoglucuronide F | ||
+ | ** oleanolic acid 3-O-glucuronide | ||
+ | ** oleanolic acid 3-O-monoglucuronide | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-9000]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659092 90659092] |
− | * LIGAND- | + | * HMDB : HMDB40851 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37658 37658] |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08964 C08964] | |
− | {{#set: | + | {{#set: smiles=CC6(CCC5(CCC1(C(=CC[CH]2(C1(CC[CH]3(C2(CCC(C3(C)C)OC4(C(C(C(C(O4)C(=O)[O-])O)O)O))C))C))[CH]5C6)C)C(=O)[O-])C}} |
− | {{#set: | + | {{#set: common name=oleanolate 3 β-D-glucuronoside}} |
− | + | {{#set: inchi key=InChIKey=IUCHKMAZAWJNBJ-RCYXVVTDSA-L}} | |
− | {{#set: | + | {{#set: molecular weight=630.817 }} |
− | {{#set: | + | {{#set: common name=oleanolic acid 3 β-D-glucuronoside|oleanoic acid 3-O-glucuronide|monoglucuronide F|oleanolic acid 3-O-glucuronide|oleanolic acid 3-O-monoglucuronide}} |
− | {{#set: | + | {{#set: produced by=RXN-9000}} |
− | + |
Latest revision as of 21:18, 21 March 2018
Contents
Metabolite CPD-9460
- smiles:
- CC6(CCC5(CCC1(C(=CC[CH]2(C1(CC[CH]3(C2(CCC(C3(C)C)OC4(C(C(C(C(O4)C(=O)[O-])O)O)O))C))C))[CH]5C6)C)C(=O)[O-])C
- common name:
- oleanolate 3 β-D-glucuronoside
- inchi key:
- InChIKey=IUCHKMAZAWJNBJ-RCYXVVTDSA-L
- molecular weight:
- 630.817
- Synonym(s):
- oleanolic acid 3 β-D-glucuronoside
- oleanoic acid 3-O-glucuronide
- monoglucuronide F
- oleanolic acid 3-O-glucuronide
- oleanolic acid 3-O-monoglucuronide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC6(CCC5(CCC1(C(=CC[CH]2(C1(CC[CH]3(C2(CCC(C3(C)C)OC4(C(C(C(C(O4)C(=O)[O-])O)O)O))C))C))[CH]5C6)C)C(=O)[O-])C" cannot be used as a page name in this wiki.