Difference between revisions of "CPD-7100"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1381 RXN-1381] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * common name: ** (2S)-2-iso...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1381 RXN-1381] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/2.3.1.15 EC-2.3.1.15]
+
** (2S)-2-isopropyl-3-oxosuccinate
 +
* inchi key:
 +
** InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L
 +
* molecular weight:
 +
** 172.137   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-isopropyl-3-oxosuccinate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-7800]]
** 1 [[GLYCEROL-3P]][c] '''+''' 1 [[Long-Chain-Acyl-CoAs]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[ACYL-SN-GLYCEROL-3P]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[IMDH]]
** 1 sn-glycerol 3-phosphate[c] '''+''' 1 a long-chain acyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 a 1-acyl-sn-glycerol 3-phosphate[c]
+
== Reaction(s) of unknown directionality ==
 
+
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-5667]], CDP-diacylglycerol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5667 PWY-5667]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
+
* [[TRIGLSYN-PWY]], diacylglycerol and triacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRIGLSYN-PWY TRIGLSYN-PWY]
+
** '''7''' reactions found over '''7''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* LIGAND-CPD:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15325 15325]
+
** [http://www.genome.jp/dbget-bin/www_bget?C04236 C04236]
* LIGAND-RXN:
+
* HMDB : HMDB12149
** [http://www.genome.jp/dbget-bin/www_bget?R00851 R00851]
+
* CHEBI:
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17214 17214]
{{#set: ec number=EC-2.3.1.15}}
+
* BIGG : 3c4mop
{{#set: in pathway=PWY-5667|TRIGLSYN-PWY}}
+
* PUBCHEM:
{{#set: reconstruction category=annotation}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419705 6419705]
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=CC(C(C(=O)[O-])C(=O)C(=O)[O-])C}}
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: common name=(2S)-2-isopropyl-3-oxosuccinate}}
 +
{{#set: inchi key=InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L}}
 +
{{#set: molecular weight=172.137    }}
 +
{{#set: common name=2-isopropyl-3-oxosuccinate}}
 +
{{#set: consumed by=RXN-7800}}
 +
{{#set: produced by=IMDH}}
 +
{{#set: reversible reaction associated=3-ISOPROPYLMALDEHYDROG-RXN}}

Latest revision as of 21:18, 21 March 2018

Metabolite CPD-7100

  • smiles:
    • CC(C(C(=O)[O-])C(=O)C(=O)[O-])C
  • common name:
    • (2S)-2-isopropyl-3-oxosuccinate
  • inchi key:
    • InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L
  • molecular weight:
    • 172.137
  • Synonym(s):
    • 2-isopropyl-3-oxosuccinate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C(C(=O)[O-])C(=O)C(=O)[O-])C" cannot be used as a page name in this wiki.