Difference between revisions of "CPD-7100"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1381 RXN-1381] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * common name: ** (2S)-2-iso...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C |
− | * | + | * common name: |
− | ** | + | ** (2S)-2-isopropyl-3-oxosuccinate |
+ | * inchi key: | ||
+ | ** InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L | ||
+ | * molecular weight: | ||
+ | ** 172.137 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-isopropyl-3-oxosuccinate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-7800]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[IMDH]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[3-ISOPROPYLMALDEHYDROG-RXN]] | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | = | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04236 C04236] |
− | * | + | * HMDB : HMDB12149 |
− | ** [http:// | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17214 17214] |
− | {{#set: | + | * BIGG : 3c4mop |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419705 6419705] |
− | {{#set: | + | {{#set: smiles=CC(C(C(=O)[O-])C(=O)C(=O)[O-])C}} |
− | {{#set: | + | {{#set: common name=(2S)-2-isopropyl-3-oxosuccinate}} |
+ | {{#set: inchi key=InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L}} | ||
+ | {{#set: molecular weight=172.137 }} | ||
+ | {{#set: common name=2-isopropyl-3-oxosuccinate}} | ||
+ | {{#set: consumed by=RXN-7800}} | ||
+ | {{#set: produced by=IMDH}} | ||
+ | {{#set: reversible reaction associated=3-ISOPROPYLMALDEHYDROG-RXN}} |
Latest revision as of 21:18, 21 March 2018
Contents
Metabolite CPD-7100
- smiles:
- CC(C(C(=O)[O-])C(=O)C(=O)[O-])C
- common name:
- (2S)-2-isopropyl-3-oxosuccinate
- inchi key:
- InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L
- molecular weight:
- 172.137
- Synonym(s):
- 2-isopropyl-3-oxosuccinate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(C(=O)[O-])C(=O)C(=O)[O-])C" cannot be used as a page name in this wiki.