Difference between revisions of "Short-glucans"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-glucans Short-glucans] == * common name: ** a short glucan * Synonym(s): == Reaction(s)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-glucans Short-glucans] ==
* smiles:
+
** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O
+
* inchi key:
+
** InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L
+
 
* common name:
 
* common name:
** GDP-β-L-galactose
+
** a short glucan
* molecular weight:
+
** 603.329   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.2.1.73-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-7772]]
 
* [[RXN-1882]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a short glucan}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200538 25200538]
+
{{#set: produced by=3.2.1.73-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61454 61454]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02280 C02280]
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O}}
+
{{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L}}
+
{{#set: common name=GDP-β-L-galactose}}
+
{{#set: molecular weight=603.329    }}
+
{{#set: consumed or produced by=RXN-7772|RXN-1882}}
+

Latest revision as of 20:18, 21 March 2018

Metabolite Short-glucans

  • common name:
    • a short glucan
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links