Difference between revisions of "NAcMur-4Peptide-NAcGlc-Undecaprenols"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * inchi key: ** InChIKey=HII...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NAcMur-4Peptide-NAcGlc-Undecaprenols NAcMur-4Peptide-NAcGlc-Undecaprenols] == * common name: **...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NAcMur-4Peptide-NAcGlc-Undecaprenols NAcMur-4Peptide-NAcGlc-Undecaprenols] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a N-acetylglucosamine--N-acetylmuramyl-(tetrapeptide) pyrophosphoryl-undecaprenol |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a GlcNAc-(1->4)-MurNAc-tetrapeptide-diphosphoundecaprenol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.4.16.4-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a N-acetylglucosamine--N-acetylmuramyl-(tetrapeptide) pyrophosphoryl-undecaprenol}} | |
| − | + | {{#set: common name=a GlcNAc-(1->4)-MurNAc-tetrapeptide-diphosphoundecaprenol}} | |
| − | + | {{#set: produced by=3.4.16.4-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 21:18, 21 March 2018
Contents
Metabolite NAcMur-4Peptide-NAcGlc-Undecaprenols
- common name:
- a N-acetylglucosamine--N-acetylmuramyl-(tetrapeptide) pyrophosphoryl-undecaprenol
- Synonym(s):
- a GlcNAc-(1->4)-MurNAc-tetrapeptide-diphosphoundecaprenol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a GlcNAc-(1->4)-MurNAc-tetrapeptide-diphosphoundecaprenol" cannot be used as a page name in this wiki.
