Difference between revisions of "LEUCYLTRANSFERASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9923 CPD-9923] == * smiles: ** C1(=CC(O)C(C(=O)[O-])C(=C1)C(=O)CCC(=O)[O-]) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LEUCYLTRANSFERASE-RXN LEUCYLTRANSFERASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LEUCYLTRANSFERASE-RXN LEUCYLTRANSFERASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ORF |
− | * | + | ** leucyl_phenylalanyl-trna--protein |
− | ** | + | ** leucyl_phenylalanyl-trna--protein_transferase |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/2.3.2.6 EC-2.3.2.6] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[Charged-LEU-tRNAs]][c] '''+''' 1 [[Protein-N-terminal-L-Lysine]][c] '''=>''' 1 [[L-leucyl-L-lysyl-Protein]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[LEU-tRNAs]][c] |
− | == | + | * With common name(s): |
+ | ** 1 an L-leucyl-[tRNAleu][c] '''+''' 1 an N-terminal L-lysyl-[protein][c] '''=>''' 1 a [protein] N-terminal L-leucyl-L-lysine[c] '''+''' 1 H+[c] '''+''' 1 a tRNAleu[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_13698]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_8540]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_2584]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7801]], N-end rule pathway I (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7801 PWY-7801] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03813 R03813] | |
− | + | * UNIPROT: | |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P73571 P73571] |
− | * | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www. | + | {{#set: common name=ORF}} |
− | {{#set: | + | {{#set: common name=leucyl_phenylalanyl-trna--protein}} |
− | {{#set: | + | {{#set: common name=leucyl_phenylalanyl-trna--protein_transferase}} |
− | {{#set: common name= | + | {{#set: ec number=EC-2.3.2.6}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_13698|Tiso_gene_8540|Tiso_gene_2584}} |
− | {{#set: | + | {{#set: in pathway=PWY-7801}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
+ | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:19, 21 March 2018
Contents
Reaction LEUCYLTRANSFERASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- ORF
- leucyl_phenylalanyl-trna--protein
- leucyl_phenylalanyl-trna--protein_transferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Charged-LEU-tRNAs[c] + 1 Protein-N-terminal-L-Lysine[c] => 1 L-leucyl-L-lysyl-Protein[c] + 1 PROTON[c] + 1 LEU-tRNAs[c]
- With common name(s):
- 1 an L-leucyl-[tRNAleu][c] + 1 an N-terminal L-lysyl-[protein][c] => 1 a [protein] N-terminal L-leucyl-L-lysine[c] + 1 H+[c] + 1 a tRNAleu[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13698
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_8540
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_2584
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7801, N-end rule pathway I (prokaryotic): PWY-7801
- 2 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links