Difference between revisions of "Tiso gene 17975"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10825 CPD-10825] == * smiles: ** CC1(=C(OC(C1)=O)CC([O-])=O) * inchi key: ** InChIKey=DAJDH...") |
(Created page with "Category:Gene == Gene Tiso_gene_17975 == * right end position: ** 3329 * transcription direction: ** POSITIVE * left end position: ** 105 * centisome position: ** 3.144654...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_17975 == |
| − | * | + | * right end position: |
| − | ** | + | ** 3329 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 105 |
| − | * | + | * centisome position: |
| − | ** | + | ** 3.1446543 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[RXN-7741]] |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | == | + | *** Assignment: automated-name-match |
| + | == Pathways associated == | ||
| + | * [[PWY-5098]] | ||
| + | * [[PWY-6927]] | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=3329}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | {{#set: | + | {{#set: left end position=105}} |
| − | {{#set: | + | {{#set: centisome position=3.1446543 }} |
| − | {{#set: | + | {{#set: reaction associated=RXN-7741}} |
| − | {{#set: | + | {{#set: pathway associated=PWY-5098|PWY-6927}} |
| − | {{#set: | + | |
Latest revision as of 20:19, 21 March 2018
Gene Tiso_gene_17975
- right end position:
- 3329
- transcription direction:
- POSITIVE
- left end position:
- 105
- centisome position:
- 3.1446543
- Synonym(s):
Reactions associated
- Reaction: RXN-7741
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
