Difference between revisions of "CPD-7137"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOADIPATE-ENOL-LACTONE 3-OXOADIPATE-ENOL-LACTONE] == * smiles: ** C(=O)(CC1(=CCC(=O)O1))[O-]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] == * smiles: ** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7137 CPD-7137] == |
* smiles: | * smiles: | ||
− | ** C(=O)( | + | ** C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** pelargonidin-3,5-di-O-β-D-glucoside |
+ | * inchi key: | ||
+ | ** InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 594.525 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7828]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167643 167643] |
− | * | + | * HMDB : HMDB33681 |
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57503 57503] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08725 C08725] |
− | {{#set: smiles=C(=O)( | + | {{#set: smiles=C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)}} |
− | + | {{#set: common name=pelargonidin-3,5-di-O-β-D-glucoside}} | |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N}} |
− | {{#set: | + | {{#set: molecular weight=594.525 }} |
− | {{#set: | + | {{#set: produced by=RXN-7828}} |
− | {{#set: | + |
Latest revision as of 20:19, 21 March 2018
Contents
Metabolite CPD-7137
- smiles:
- C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)
- common name:
- pelargonidin-3,5-di-O-β-D-glucoside
- inchi key:
- InChIKey=SLCKJKWFULXZBD-ZOTFFYTFSA-N
- molecular weight:
- 594.525
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C5(C(C(C(C(OC3(=CC([O-])=CC2([O+]=C(C1(=CC=C(O)C=C1))C(=CC=23)OC4(C(O)C(O)C(O)C(CO)O4))))O5)O)O)O)" cannot be used as a page name in this wiki.