Difference between revisions of "ALL-TRANS-HEXAPRENYL-DIPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SE-2 SE-2] == * smiles: ** [Se--] * inchi key: ** InChIKey=HMUBNCUQSSTAIB-UHFFFAOYSA-N * common...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALL-TRANS-HEXAPRENYL-DIPHOSPHATE ALL-TRANS-HEXAPRENYL-DIPHOSPHATE] == * smiles: ** CC(C)=CCCC(C...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALL-TRANS-HEXAPRENYL-DIPHOSPHATE ALL-TRANS-HEXAPRENYL-DIPHOSPHATE] == |
* smiles: | * smiles: | ||
| − | ** [ | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** all-trans-hexaprenyl diphosphate |
| + | * inchi key: | ||
| + | ** InChIKey=NGFSMHKFTZROKJ-MMSZMYIBSA-K | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 583.66 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** hexaprenyl-diphosphate |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9003]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246217 25246217] |
| − | * | + | * HMDB : HMDB12188 |
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58179 58179] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=[ | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01230 C01230] |
| − | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]}} |
| − | {{#set: | + | {{#set: common name=all-trans-hexaprenyl diphosphate}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=NGFSMHKFTZROKJ-MMSZMYIBSA-K}} |
| − | {{#set: common name= | + | {{#set: molecular weight=583.66 }} |
| − | {{#set: consumed by= | + | {{#set: common name=hexaprenyl-diphosphate}} |
| + | {{#set: consumed by=RXN-9003}} | ||
Latest revision as of 20:19, 21 March 2018
Contents
Metabolite ALL-TRANS-HEXAPRENYL-DIPHOSPHATE
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]
- common name:
- all-trans-hexaprenyl diphosphate
- inchi key:
- InChIKey=NGFSMHKFTZROKJ-MMSZMYIBSA-K
- molecular weight:
- 583.66
- Synonym(s):
- hexaprenyl-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-" cannot be used as a page name in this wiki.
