Difference between revisions of "UDP-D-GALACTO-14-FURANOSE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=KDGALDOL-RXN KDGALDOL-RXN] == * direction: ** REVERSIBLE * common name: ** 2-dehydro-3-deoxyglucara...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTO-14-FURANOSE UDP-D-GALACTO-14-FURANOSE] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTO-14-FURANOSE UDP-D-GALACTO-14-FURANOSE] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)) |
* common name: | * common name: | ||
− | ** | + | ** UDP-α-D-galactofuranose |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ZQLQOXLUCGXKHS-SIAUPFDVSA-L |
+ | * molecular weight: | ||
+ | ** 564.289 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** UDP-Galf | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[GALPMUT-RXN]] | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244316 25244316] |
− | * LIGAND- | + | * CHEBI: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66915 66915] |
− | {{#set: | + | * BIGG : udpgalfur |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03733 C03733] | |
− | {{#set: | + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))}} |
− | {{#set: | + | {{#set: common name=UDP-α-D-galactofuranose}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=ZQLQOXLUCGXKHS-SIAUPFDVSA-L}} |
− | {{#set: | + | {{#set: molecular weight=564.289 }} |
− | {{#set: | + | {{#set: common name=UDP-Galf}} |
+ | {{#set: reversible reaction associated=GALPMUT-RXN}} |
Latest revision as of 21:19, 21 March 2018
Contents
Metabolite UDP-D-GALACTO-14-FURANOSE
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))
- common name:
- UDP-α-D-galactofuranose
- inchi key:
- InChIKey=ZQLQOXLUCGXKHS-SIAUPFDVSA-L
- molecular weight:
- 564.289
- Synonym(s):
- UDP-Galf
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))" cannot be used as a page name in this wiki.