Difference between revisions of "D-RIBULOSE-15-P2"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7440 == * Synonym(s): == Reactions associated == * GLUC1PURIDYLTRANS-RXN ** pantograph-esiliculosus == Pathways associated ==...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE-15-P2 D-RIBULOSE-15-P2] == * smiles: ** C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-]...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE-15-P2 D-RIBULOSE-15-P2] == |
| + | * smiles: | ||
| + | ** C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-] | ||
| + | * common name: | ||
| + | ** D-ribulose-1,5-bisphosphate | ||
| + | * inchi key: | ||
| + | ** InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J | ||
| + | * molecular weight: | ||
| + | ** 306.059 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** ribulose 1,5-bisphosphate | ||
| + | ** D-ribulose-1,5-diphosphate | ||
| + | ** D-ribulose-1,5-P2 | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | * [[PHOSPHORIBULOKINASE-RXN]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 14689-84-0 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615473 23615473] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.3541504.html 3541504] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57870 57870] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01182 C01182] | ||
| + | {{#set: smiles=C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]}} | ||
| + | {{#set: common name=D-ribulose-1,5-bisphosphate}} | ||
| + | {{#set: inchi key=InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J}} | ||
| + | {{#set: molecular weight=306.059 }} | ||
| + | {{#set: common name=ribulose 1,5-bisphosphate|D-ribulose-1,5-diphosphate|D-ribulose-1,5-P2}} | ||
| + | {{#set: consumed by=RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN}} | ||
| + | {{#set: reversible reaction associated=PHOSPHORIBULOKINASE-RXN}} | ||
Latest revision as of 20:20, 21 March 2018
Contents
Metabolite D-RIBULOSE-15-P2
- smiles:
- C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]
- common name:
- D-ribulose-1,5-bisphosphate
- inchi key:
- InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J
- molecular weight:
- 306.059
- Synonym(s):
- ribulose 1,5-bisphosphate
- D-ribulose-1,5-diphosphate
- D-ribulose-1,5-P2
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.
