Difference between revisions of "RXN66-181"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-4-PHOSPHATE D-MYO-INOSITOL-4-PHOSPHATE] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-181 RXN66-181] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-4-PHOSPHATE D-MYO-INOSITOL-4-PHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-181 RXN66-181] ==
* smiles:
+
* direction:
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=INAPMGSXUVUWAF-CNWJWELYSA-L
+
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
* common name:
+
** 1D-myo-inositol 4-monophosphate
+
* molecular weight:
+
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
** D-myo-inositol 4-phosphate
 
** D-myo-inositol 4-monophosphate
 
** inositol 4-phosphate
 
** Ins(4)P1
 
** Ins(4)P
 
** Ins4P
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10952]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-3481]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[CPD-3483]][c]
* [[3.1.3.57-RXN]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 bupropion[c] '''+''' 1 oxygen[c] '''+''' 1 a reduced [NADPH-hemoprotein reductase][c] '''=>''' 1 H2O[c] '''+''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 hydroxybupropion[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_1035]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY66-241]], bupropion degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-241 PWY66-241]
 +
** '''1''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 46495-39-0
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: ec number=EC-1.14.14.1}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200523 25200523]
+
{{#set: gene associated=Tiso_gene_1035}}
* HMDB : HMDB01313
+
{{#set: in pathway=PWY66-241}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C03546 C03546]
+
{{#set: reconstruction source=orthology-esiliculosus}}
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58469 58469]
+
* METABOLIGHTS : MTBLC58469
+
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
+
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-CNWJWELYSA-L}}
+
{{#set: common name=1D-myo-inositol 4-monophosphate}}
+
{{#set: molecular weight=258.121    }}
+
{{#set: common name=D-myo-inositol 4-phosphate|D-myo-inositol 4-monophosphate|inositol 4-phosphate|Ins(4)P1|Ins(4)P|Ins4P}}
+
{{#set: consumed by=RXN-10952}}
+
{{#set: produced by=3.1.3.57-RXN}}
+

Latest revision as of 20:20, 21 March 2018

Reaction RXN66-181

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-241, bupropion degradation: PWY66-241
    • 1 reactions found over 5 reactions in the full pathway

Reconstruction information

External links