Difference between revisions of "RXN-10827"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12481 CPD-12481] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N2)) * inchi key: ** InChIKey=Y...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10827 RXN-10827] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10827 RXN-10827] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.7.8.23 EC-2.7.8.23] | |
− | * | + | |
− | ** 7- | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[1-CARBOXYVINYL-CARBOXYPHOSPHONATE]][c] '''=>''' 1 [[CPD-11740]][c] |
− | == | + | * With common name(s): |
+ | ** 1 carboxyphosphonoenolpyruvate[c] '''=>''' 1 carboxyphosphinopyruvate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_2241]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6322]], phosphinothricin tripeptide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6322 PWY-6322] | ||
+ | ** '''2''' reactions found over '''25''' reactions in the full pathway | ||
+ | * [[PWY-7769]], phosalacine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7769 PWY-7769] | ||
+ | ** '''2''' reactions found over '''25''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R08868 R08868] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-2.7.8.23}} | |
− | + | {{#set: gene associated=Tiso_gene_2241}} | |
− | + | {{#set: in pathway=PWY-6322|PWY-7769}} | |
− | * LIGAND- | + | {{#set: reconstruction category=orthology}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction source=orthology-esiliculosus}} |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:20, 21 March 2018
Contents
Reaction RXN-10827
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 1-CARBOXYVINYL-CARBOXYPHOSPHONATE[c] => 1 CPD-11740[c]
- With common name(s):
- 1 carboxyphosphonoenolpyruvate[c] => 1 carboxyphosphinopyruvate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2241
- Source: orthology-esiliculosus
Pathways
- PWY-6322, phosphinothricin tripeptide biosynthesis: PWY-6322
- 2 reactions found over 25 reactions in the full pathway
- PWY-7769, phosalacine biosynthesis: PWY-7769
- 2 reactions found over 25 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
- LIGAND-RXN: