Difference between revisions of "ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11474 RXN-11474] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-glutaryl-[acp] methyl...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] == * smiles: ** C([N...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11474 RXN-11474] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C([N+])COP([O-])(=O)OCC(O)CO[R]
 
* common name:
 
* common name:
** 3-oxo-glutaryl-[acp] methyl ester synthase
+
** 1-alkyl-sn-glycero-3-phosphoethanolamine
** 3-oxoacyl-synthase
+
* ec number:
+
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** 1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine
 +
** 1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine
 +
** 1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[MALONYL-ACP]][c] '''+''' 1 [[Malonyl-acp-methyl-ester]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[3-Ketoglutaryl-ACP-methyl-ester]][c] '''+''' 1 [[ACP]][c]
+
* [[LPLPS1AGPE180]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 a malonyl-[acp][c] '''+''' 1 a malonyl-[acp] methyl ester[c] '''+''' 1 H+[c] '''=>''' 1 CO2[c] '''+''' 1 a 3-oxo-glutaryl-[acp] methyl ester[c] '''+''' 1 a holo-[acyl-carrier protein][c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_15991]]
+
** [[pantograph]]-[[esiliculosus]]
+
* [[Tiso_gene_19302]]
+
** [[pantograph]]-[[esiliculosus]]
+
* [[Tiso_gene_5939]]
+
** IN-SILICO_ANNOTATION
+
***EC-NUMBER
+
** EXPERIMENTAL_ANNOTATION
+
***EC-NUMBER
+
* [[Tiso_gene_14485]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
+
** '''9''' reactions found over '''11''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[esiliculosus]]
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[experimental_annotation]]
+
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
{{#set: common name=3-oxo-glutaryl-[acp] methyl ester synthase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04476 C04476]
{{#set: common name=3-oxoacyl-synthase}}
+
* CHEBI:
{{#set: ec number=EC-2.3.1.41}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18244 18244]
{{#set: gene associated=Tiso_gene_15991|Tiso_gene_19302|Tiso_gene_5939|Tiso_gene_14485}}
+
{{#set: smiles=C([N+])COP([O-])(=O)OCC(O)CO[R]}}
{{#set: in pathway=PWY-6519}}
+
{{#set: common name=1-alkyl-sn-glycero-3-phosphoethanolamine}}
{{#set: reconstruction category=orthology}}
+
{{#set: common name=1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine|1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine|1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=LPLPS1AGPE180}}
{{#set: reconstruction source=esiliculosus}}
+
{{#set: reconstruction category=annotation}}
+
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+

Latest revision as of 20:20, 21 March 2018

Metabolite ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE

  • smiles:
    • C([N+])COP([O-])(=O)OCC(O)CO[R]
  • common name:
    • 1-alkyl-sn-glycero-3-phosphoethanolamine
  • Synonym(s):
    • 1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine
    • 1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine
    • 1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([N+])COP([O-])(=O)OCC(O)CO[R" cannot be used as a page name in this wiki.