Difference between revisions of "ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11474 RXN-11474] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-glutaryl-[acp] methyl...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] == * smiles: ** C([N...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE] == |
− | * | + | * smiles: |
− | ** | + | ** C([N+])COP([O-])(=O)OCC(O)CO[R] |
* common name: | * common name: | ||
− | ** | + | ** 1-alkyl-sn-glycero-3-phosphoethanolamine |
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine | ||
+ | ** 1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine | ||
+ | ** 1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[LPLPS1AGPE180]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04476 C04476] |
− | {{#set: common name=3- | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18244 18244] | |
− | + | {{#set: smiles=C([N+])COP([O-])(=O)OCC(O)CO[R]}} | |
− | + | {{#set: common name=1-alkyl-sn-glycero-3-phosphoethanolamine}} | |
− | {{#set: | + | {{#set: common name=1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine|1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine|1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine}} |
− | + | {{#set: produced by=LPLPS1AGPE180}} | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 21:20, 21 March 2018
Contents
Metabolite ALKYL-SN-GLYCERO-PHOSPHOETHANOLAMINE
- smiles:
- C([N+])COP([O-])(=O)OCC(O)CO[R]
- common name:
- 1-alkyl-sn-glycero-3-phosphoethanolamine
- Synonym(s):
- 1-alkyl-2-lysosnn-glycero-3-phosphoethanolamine
- 1-radyl-2-lyso-sn-glycero-3-phosphoethanolamine
- 1-organyl-2-lyso-sn-glycero-3-phosphoethanolamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])COP([O-])(=O)OCC(O)CO[R" cannot be used as a page name in this wiki.