Difference between revisions of "Tiso gene 17819"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-8-DIHYDROPTEROATE 7-8-DIHYDROPTEROATE] == * smiles: ** C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C...")
(Created page with "Category:Gene == Gene Tiso_gene_17819 == * right end position: ** 2031 * transcription direction: ** NEGATIVE * left end position: ** 17 * centisome position: ** 0.4941860...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-8-DIHYDROPTEROATE 7-8-DIHYDROPTEROATE] ==
+
== Gene Tiso_gene_17819 ==
−
* smiles:
+
* right end position:
−
** C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))
+
** 2031
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WBFYVDCHGVNRBH-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** 7,8-dihydropteroate
+
** 17
−
* molecular weight:
+
* centisome position:
−
** 313.295    
+
** 0.49418607    
 
* Synonym(s):
 
* Synonym(s):
−
** dihydropterate
 
−
** H2Pte
 
−
** dihydropteroate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[DIHYDROFOLATESYNTH-RXN]]
+
* Reaction: [[RXN-11109]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[H2PTEROATESYNTH-RXN]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
−
* [[RXN-14226]]
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2031}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459950 5459950]
+
{{#set: transcription direction=NEGATIVE}}
−
* HMDB : HMDB01412
+
{{#set: left end position=17}}
−
* LIGAND-CPD:
+
{{#set: centisome position=0.49418607   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00921 C00921]
+
{{#set: reaction associated=RXN-11109}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4573669.html 4573669]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17839 17839]
+
−
* BIGG : dhpt
+
−
{{#set: smiles=C(NC1(=CC=C(C(=O)[O-])C=C1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))}}
+
−
{{#set: inchi key=InChIKey=WBFYVDCHGVNRBH-UHFFFAOYSA-M}}
+
−
{{#set: common name=7,8-dihydropteroate}}
+
−
{{#set: molecular weight=313.295   }}
+
−
{{#set: common name=dihydropterate|H2Pte|dihydropteroate}}
+
−
{{#set: consumed by=DIHYDROFOLATESYNTH-RXN}}
+
−
{{#set: produced by=H2PTEROATESYNTH-RXN}}
+
−
{{#set: consumed or produced by=RXN-14226}}
+

Latest revision as of 21:20, 21 March 2018

Gene Tiso_gene_17819

  • right end position:
    • 2031
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 17
  • centisome position:
    • 0.49418607
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17819&oldid=47924"