Difference between revisions of "Tiso gene 5047"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=25-DIDEHYDRO-D-GLUCONATE 25-DIDEHYDRO-D-GLUCONATE] == * smiles: ** C(C(C(C(C(C([O-])=O)=O)O)O)=...")
(Created page with "Category:Gene == Gene Tiso_gene_5047 == * right end position: ** 13971 * transcription direction: ** POSITIVE * left end position: ** 11687 * centisome position: ** 83.639...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=25-DIDEHYDRO-D-GLUCONATE 25-DIDEHYDRO-D-GLUCONATE] ==
+
== Gene Tiso_gene_5047 ==
−
* smiles:
+
* right end position:
−
** C(C(C(C(C(C([O-])=O)=O)O)O)=O)O
+
** 13971
−
* inchi key:
+
* transcription direction:
−
** InChIKey=RXMWXENJQAINCC-DMTCNVIQSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 2,5-didehydro-D-gluconate
+
** 11687
−
* molecular weight:
+
* centisome position:
−
** 191.117    
+
** 83.63988    
 
* Synonym(s):
 
* Synonym(s):
−
** 2,5-diketo-D-gluconate
 
−
** 2,5-diketogluconic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[HISTCYCLOHYD-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[1.1.1.274-RXN]]
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[HISTSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=13971}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9548631 9548631]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=11687}}
−
** [http://www.chemspider.com/Chemical-Structure.7827554.html 7827554]
+
{{#set: centisome position=83.63988   }}
−
* CHEBI:
+
{{#set: reaction associated=HISTCYCLOHYD-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11449 11449]
+
{{#set: pathway associated=HISTSYN-PWY}}
−
* BIGG : 25dkglcn
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02780 C02780]
+
−
{{#set: smiles=C(C(C(C(C(C([O-])=O)=O)O)O)=O)O}}
+
−
{{#set: inchi key=InChIKey=RXMWXENJQAINCC-DMTCNVIQSA-M}}
+
−
{{#set: common name=2,5-didehydro-D-gluconate}}
+
−
{{#set: molecular weight=191.117   }}
+
−
{{#set: common name=2,5-diketo-D-gluconate|2,5-diketogluconic acid}}
+
−
{{#set: consumed or produced by=1.1.1.274-RXN}}
+

Latest revision as of 20:20, 21 March 2018

Gene Tiso_gene_5047

  • right end position:
    • 13971
  • transcription direction:
    • POSITIVE
  • left end position:
    • 11687
  • centisome position:
    • 83.63988
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5047&oldid=47951"