Difference between revisions of "ACOA160or"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-HYDROXYPYRUVATE 3-P-HYDROXYPYRUVATE] == * smiles: ** C(OP([O-])(=O)[O-])C(=O)C(=O)[O-] * in...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACOA160or ACOA160or] == * direction: ** LEFT-TO-RIGHT * common name: ** Palmitoyl-CoA:oxygen 2-oxid...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-HYDROXYPYRUVATE 3-P-HYDROXYPYRUVATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACOA160or ACOA160or] ==
−
* smiles:
+
* direction:
−
** C(OP([O-])(=O)[O-])C(=O)C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LFLUCDOSQPJJBE-UHFFFAOYSA-K
+
 
* common name:
 
* common name:
−
** 3-phospho-hydroxypyruvate
+
** Palmitoyl-CoA:oxygen 2-oxidoreductase
−
* molecular weight:
+
−
** 181.018   
+
 
* Synonym(s):
 
* Synonym(s):
−
** phosphohydroxypyruvate
 
−
** 3-phosphonooxypyruvate
 
−
** 3-P-hydroxypyruvate
 
−
** 3-p-OH-pyr
 
−
** 3-phosphohydroxypyruvate
 
−
** 3-p-OH-pyruvate
 
−
** 3-p-hydroxy-pyr
 
−
** 3-phosphohydroxy-pyr
 
−
** phosphohydroxypyruate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1.0 [[PALMITYL-COA]][x] '''+''' 1.0 [[FAD]][x] '''=>''' 1.0 [[CPD0-2117]][x] '''+''' 1.0 [[FADH2]][x]
−
* [[PSERTRANSAM-RXN]]
+
* With common name(s):
−
* [[PGLYCDEHYDROG-RXN]]
+
** 1.0 palmitoyl-CoA[x] '''+''' 1.0 FAD[x] '''=>''' 1.0 trans-hexadec-2-enoyl-CoA[x] '''+''' 1.0 FADH2[x]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18566]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_17967]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_8272]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_16674]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 3913-50-6
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC18110
+
{{#set: common name=Palmitoyl-CoA:oxygen 2-oxidoreductase}}
−
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_18566|Tiso_gene_17967|Tiso_gene_8272|Tiso_gene_16674}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460375 5460375]
+
{{#set: in pathway=}}
−
* HMDB : HMDB01024
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03232 C03232]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4573923.html 4573923]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18110 18110]
+
−
* BIGG : 3php
+
−
{{#set: smiles=C(OP([O-])(=O)[O-])C(=O)C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=LFLUCDOSQPJJBE-UHFFFAOYSA-K}}
+
−
{{#set: common name=3-phospho-hydroxypyruvate}}
+
−
{{#set: molecular weight=181.018    }}
+
−
{{#set: common name=phosphohydroxypyruvate|3-phosphonooxypyruvate|3-P-hydroxypyruvate|3-p-OH-pyr|3-phosphohydroxypyruvate|3-p-OH-pyruvate|3-p-hydroxy-pyr|3-phosphohydroxy-pyr|phosphohydroxypyruate}}
+
−
{{#set: consumed or produced by=PSERTRANSAM-RXN|PGLYCDEHYDROG-RXN}}
+

Latest revision as of 20:20, 21 March 2018

Reaction ACOA160or

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Palmitoyl-CoA:oxygen 2-oxidoreductase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 palmitoyl-CoA[x] + 1.0 FAD[x] => 1.0 trans-hexadec-2-enoyl-CoA[x] + 1.0 FADH2[x]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ACOA160or&oldid=47957"