Difference between revisions of "ACOA160or"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-HYDROXYPYRUVATE 3-P-HYDROXYPYRUVATE] == * smiles: ** C(OP([O-])(=O)[O-])C(=O)C(=O)[O-] * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACOA160or ACOA160or] == * direction: ** LEFT-TO-RIGHT * common name: ** Palmitoyl-CoA:oxygen 2-oxid...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACOA160or ACOA160or] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Palmitoyl-CoA:oxygen 2-oxidoreductase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1.0 [[PALMITYL-COA]][x] '''+''' 1.0 [[FAD]][x] '''=>''' 1.0 [[CPD0-2117]][x] '''+''' 1.0 [[FADH2]][x] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1.0 palmitoyl-CoA[x] '''+''' 1.0 FAD[x] '''=>''' 1.0 trans-hexadec-2-enoyl-CoA[x] '''+''' 1.0 FADH2[x] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_18566]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_17967]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_8272]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Gene: [[Tiso_gene_16674]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Palmitoyl-CoA:oxygen 2-oxidoreductase}} | |
− | + | {{#set: gene associated=Tiso_gene_18566|Tiso_gene_17967|Tiso_gene_8272|Tiso_gene_16674}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:20, 21 March 2018
Contents
Reaction ACOA160or
- direction:
- LEFT-TO-RIGHT
- common name:
- Palmitoyl-CoA:oxygen 2-oxidoreductase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 PALMITYL-COA[x] + 1.0 FAD[x] => 1.0 CPD0-2117[x] + 1.0 FADH2[x]
- With common name(s):
- 1.0 palmitoyl-CoA[x] + 1.0 FAD[x] => 1.0 trans-hexadec-2-enoyl-CoA[x] + 1.0 FADH2[x]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18566
- Source: orthology-creinhardtii
- Gene: Tiso_gene_17967
- Source: orthology-creinhardtii
- Gene: Tiso_gene_8272
- Source: orthology-creinhardtii
- Gene: Tiso_gene_16674
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii