Difference between revisions of "NN-DIMETHYLANILINE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMATE-SYNTHASE-FERREDOXIN-RXN GLUTAMATE-SYNTHASE-FERREDOXIN-RXN] == * direction: ** LEFT-TO-RIG...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE NN-DIMETHYLANILINE] == * smiles: ** CN(C1(C=CC=CC=1))C * common name: ** N,N...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE NN-DIMETHYLANILINE] == |
− | * | + | * smiles: |
− | ** | + | ** CN(C1(C=CC=CC=1))C |
* common name: | * common name: | ||
− | ** | + | ** N,N-dimethylaniline |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N |
+ | * molecular weight: | ||
+ | ** 121.182 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[1.14.13.8-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=949 949] |
− | * | + | * NCI: |
− | ** [http:// | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=7195 7195] |
− | + | * HMDB : HMDB01020 | |
− | + | * LIGAND-CPD: | |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02846 C02846] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.924.html 924] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16269 16269] |
− | + | {{#set: smiles=CN(C1(C=CC=CC=1))C}} | |
− | * | + | {{#set: common name=N,N-dimethylaniline}} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N}} |
− | + | {{#set: molecular weight=121.182 }} | |
− | + | {{#set: consumed by=1.14.13.8-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:20, 21 March 2018
Contents
Metabolite NN-DIMETHYLANILINE
- smiles:
- CN(C1(C=CC=CC=1))C
- common name:
- N,N-dimethylaniline
- inchi key:
- InChIKey=JLTDJTHDQAWBAV-UHFFFAOYSA-N
- molecular weight:
- 121.182
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links