Difference between revisions of "1-CHLORO-24-DINITROBENZENE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2283 == * left end position: ** 4493 * transcription direction: ** POSITIVE * right end position: ** 4749 * centisome position: ** 22.57108...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-CHLORO-24-DINITROBENZENE 1-CHLORO-24-DINITROBENZENE] == * smiles: ** C1(C=C(Cl)C(=CC=1[N+]([O...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-CHLORO-24-DINITROBENZENE 1-CHLORO-24-DINITROBENZENE] == |
− | * | + | * smiles: |
− | ** | + | ** C1(C=C(Cl)C(=CC=1[N+]([O-])=O)[N+]([O-])=O) |
− | * | + | * common name: |
− | ** | + | ** 1-chloro-2,4-dinitrobenzene |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=VYZAHLCBVHPDDF-UHFFFAOYSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 202.554 |
* Synonym(s): | * Synonym(s): | ||
+ | ** CDNB | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[GST-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6 6] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.13868426.html 13868426] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34718 34718] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C14397 C14397] | ||
+ | * NCI: | ||
+ | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6292 6292] | ||
+ | {{#set: smiles=C1(C=C(Cl)C(=CC=1[N+]([O-])=O)[N+]([O-])=O)}} | ||
+ | {{#set: common name=1-chloro-2,4-dinitrobenzene}} | ||
+ | {{#set: inchi key=InChIKey=VYZAHLCBVHPDDF-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=202.554 }} | ||
+ | {{#set: common name=CDNB}} | ||
+ | {{#set: reversible reaction associated=GST-RXN}} |
Latest revision as of 19:21, 21 March 2018
Contents
Metabolite 1-CHLORO-24-DINITROBENZENE
- smiles:
- C1(C=C(Cl)C(=CC=1[N+]([O-])=O)[N+]([O-])=O)
- common name:
- 1-chloro-2,4-dinitrobenzene
- inchi key:
- InChIKey=VYZAHLCBVHPDDF-UHFFFAOYSA-N
- molecular weight:
- 202.554
- Synonym(s):
- CDNB
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C=C(Cl)C(=CC=1[N+]([O-])=O)[N+]([O-])=O)" cannot be used as a page name in this wiki.