Difference between revisions of "CPD-16491"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_17 == * left end position: ** 16660 * transcription direction: ** POSITIVE * right end position: ** 18409 * centisome position: ** 33.61107...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] == * smiles: ** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1) * common name: ** 2,6-dia...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_17 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16491 CPD-16491] ==
* left end position:
+
* smiles:
** 16660
+
** CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)
* transcription direction:
+
* common name:
** POSITIVE
+
** 2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine
* right end position:
+
* inchi key:
** 18409
+
** InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N
* centisome position:
+
* molecular weight:
** 33.611073    
+
** 183.169    
 
* Synonym(s):
 
* Synonym(s):
 +
** N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[3.2.2.23-RXN]]
***ec-number
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN0-1321]]
+
** in-silico_annotation
+
***ec-number
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways associated ==
+
* [[PWY-6700]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=16660}}
+
* LIGAND-CPD:
{{#set: transcription direction=POSITIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04744 C04744]
{{#set: right end position=18409}}
+
* CHEBI:
{{#set: centisome position=33.611073   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28643 28643]
{{#set: reaction associated=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN|RXN0-1321}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-6700}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=127546 127546]
 +
* HMDB : HMDB11657
 +
{{#set: smiles=CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)}}
 +
{{#set: common name=2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine}}
 +
{{#set: inchi key=InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=183.169   }}
 +
{{#set: common name=N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide}}
 +
{{#set: produced by=3.2.2.23-RXN}}

Latest revision as of 20:21, 21 March 2018

Metabolite CPD-16491

  • smiles:
    • CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)
  • common name:
    • 2,6-diamino-4-hydroxy-5-(N-methyl)formamidopyrimidine
  • inchi key:
    • InChIKey=CGWDNAFNQOBSCK-UHFFFAOYSA-N
  • molecular weight:
    • 183.169
  • Synonym(s):
    • N-(2,4-diamino-6-hydroxypyrimidin-5-yl)-N-methylformamide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CN([CH]=O)C1(C(O)=NC(N)=NC(N)=1)" cannot be used as a page name in this wiki.