Difference between revisions of "CPDQT-37"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12347 RXN-12347] == * direction: ** LEFT-TO-RIGHT * common name: ** s-adenosylmethionine:diacyl...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] == * smiles: ** CSCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(4'-meth...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12347 RXN-12347] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-37 CPDQT-37] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CSCCCCC(C(O)C(=O)[O-])C(=O)[O-]
 
* common name:
 
* common name:
−
** s-adenosylmethionine:diacylglycerol_3-amino-3-carboxypropyl_transferase
+
** 3-(4'-methylthio)butylmalate
 +
* inchi key:
 +
** InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 234.267   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-(4'-methylthio)butylmalic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXNQT-4168]]
−
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[DIACYLGLYCEROL]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[5-METHYLTHIOADENOSINE]][c] '''+''' 1 [[Diacylglycerolhomoserines]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 S-adenosyl-L-methionine[c] '''+''' 1 a 1,2-diacyl-sn-glycerol[c] '''=>''' 1 H+[c] '''+''' 1 S-methyl-5'-thioadenosine[c] '''+''' 1 a diacylglycerolhomoserine[c]
+
* [[RXN-18206]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14329]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-6795]], diacylglyceryl-N,N,N-trimethylhomoserine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6795 PWY-6795]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=s-adenosylmethionine:diacylglycerol_3-amino-3-carboxypropyl_transferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237164 44237164]
−
{{#set: gene associated=Tiso_gene_14329}}
+
{{#set: smiles=CSCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
−
{{#set: in pathway=PWY-6795}}
+
{{#set: common name=3-(4'-methylthio)butylmalate}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=234.267    }}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: common name=3-(4'-methylthio)butylmalic acid}}
 +
{{#set: consumed by=RXNQT-4168}}
 +
{{#set: reversible reaction associated=RXN-18206}}

Latest revision as of 21:21, 21 March 2018

Metabolite CPDQT-37

  • smiles:
    • CSCCCCC(C(O)C(=O)[O-])C(=O)[O-]
  • common name:
    • 3-(4'-methylthio)butylmalate
  • inchi key:
    • InChIKey=ZIZLDVKLMYVMNX-UHFFFAOYSA-L
  • molecular weight:
    • 234.267
  • Synonym(s):
    • 3-(4'-methylthio)butylmalic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPDQT-37&oldid=48010"