Difference between revisions of "Tiso gene 18908"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMOGENTISATE HOMOGENTISATE] == * smiles: ** C1(C(=CC(=C(C=1)O)CC([O-])=O)O) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Tiso_gene_18908 == * right end position: ** 2205 * transcription direction: ** NEGATIVE * left end position: ** 29 * centisome position: ** 1.0642202...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18908 == |
− | * | + | * right end position: |
− | ** | + | ** 2205 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 29 |
− | * | + | * centisome position: |
− | ** | + | ** 1.0642202 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | + | == Pathways associated == | |
− | * | + | |
− | * | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: right end position=2205}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=29}} | |
− | + | {{#set: centisome position=1.0642202 }} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:21, 21 March 2018
Gene Tiso_gene_18908
- right end position:
- 2205
- transcription direction:
- NEGATIVE
- left end position:
- 29
- centisome position:
- 1.0642202
- Synonym(s):
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation