Difference between revisions of "METHYL-MALONYL-COA"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5195 == * left end position: ** 1563 * transcription direction: ** POSITIVE * right end position: ** 4938 * centisome position: ** 11.33019...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYL-MALONYL-COA METHYL-MALONYL-COA] == * smiles: ** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYL-MALONYL-COA METHYL-MALONYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C([O-])=O |
− | * | + | * common name: |
− | ** | + | ** (R)-methylmalonyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=MZFOKIKEPGUZEN-AGCMQPJKSA-I |
− | * | + | * molecular weight: |
− | ** | + | ** 862.568 |
* Synonym(s): | * Synonym(s): | ||
+ | ** L-methylmalonyl-CoA | ||
+ | ** methylmalonyl-CoA | ||
+ | ** methyl-malonyl-coenzyme A | ||
+ | ** CH3-malonyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[METHYLMALONYL-COA-MUT-RXN]] | |
− | == | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01213 C01213] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57326 57326] |
− | {{#set: | + | * METABOLIGHTS : MTBLC57326 |
− | {{#set: | + | * BIGG : mmcoa__R |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266560 45266560] | ||
+ | {{#set: smiles=CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C([O-])=O}} | ||
+ | {{#set: common name=(R)-methylmalonyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=MZFOKIKEPGUZEN-AGCMQPJKSA-I}} | ||
+ | {{#set: molecular weight=862.568 }} | ||
+ | {{#set: common name=L-methylmalonyl-CoA|methylmalonyl-CoA|methyl-malonyl-coenzyme A|CH3-malonyl-CoA}} | ||
+ | {{#set: reversible reaction associated=METHYLMALONYL-COA-MUT-RXN}} |
Latest revision as of 21:21, 21 March 2018
Contents
Metabolite METHYL-MALONYL-COA
- smiles:
- CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C([O-])=O
- common name:
- (R)-methylmalonyl-CoA
- inchi key:
- InChIKey=MZFOKIKEPGUZEN-AGCMQPJKSA-I
- molecular weight:
- 862.568
- Synonym(s):
- L-methylmalonyl-CoA
- methylmalonyl-CoA
- methyl-malonyl-coenzyme A
- CH3-malonyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C([O-])=O" cannot be used as a page name in this wiki.