Difference between revisions of "1-3-alpha-D-Glucans"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9871 CPD-9871] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-3-alpha-D-Glucans 1-3-alpha-D-Glucans] == * common name: ** a 1,3-α-D-glucan * Synonym(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9871 CPD-9871] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-3-alpha-D-Glucans 1-3-alpha-D-Glucans] ==
* smiles:
+
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C)C)C
+
* inchi key:
+
** InChIKey=XCOXSBLQZPFVGK-RGIWONJESA-N
+
 
* common name:
 
* common name:
** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
+
** a 1,3-α-D-glucan
* molecular weight:
+
** 835.347   
+
 
* Synonym(s):
 
* Synonym(s):
** 6-methoxy-3-methyl-2-decaprenyl-1,4-benzoquinol
+
** 1,3-α-D-glucan
** 6-methoxy-5-methyl-2-decaprenyl-1,4-benzoquinol
+
** (1,3-α-D-glucosyl)(n)
 +
** (1,3-α-D-glucosyl)(n+1)
 +
** (1,3-α-D-glucosyl)(n-1)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.2.1.84-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9235]]
+
* [[3.2.1.84-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 1,3-α-D-glucan}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986092 50986092]
+
{{#set: common name=1,3-α-D-glucan|(1,3-α-D-glucosyl)(n)|(1,3-α-D-glucosyl)(n+1)|(1,3-α-D-glucosyl)(n-1)}}
* CHEBI:
+
{{#set: consumed by=3.2.1.84-RXN}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64181 64181]
+
{{#set: produced by=3.2.1.84-RXN}}
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(=C1C)O)O))C)C)C)C)C)C)C)C)C)C}}
+
{{#set: inchi key=InChIKey=XCOXSBLQZPFVGK-RGIWONJESA-N}}
+
{{#set: common name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}}
+
{{#set: molecular weight=835.347    }}
+
{{#set: common name=6-methoxy-3-methyl-2-decaprenyl-1,4-benzoquinol|6-methoxy-5-methyl-2-decaprenyl-1,4-benzoquinol}}
+
{{#set: produced by=RXN-9235}}
+

Latest revision as of 20:21, 21 March 2018

Metabolite 1-3-alpha-D-Glucans

  • common name:
    • a 1,3-α-D-glucan
  • Synonym(s):
    • 1,3-α-D-glucan
    • (1,3-α-D-glucosyl)(n)
    • (1,3-α-D-glucosyl)(n+1)
    • (1,3-α-D-glucosyl)(n-1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links