Difference between revisions of "34HPPYRI"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8985 CPD-8985] == * smiles: ** C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=34HPPYRI 34HPPYRI] == * direction: ** REVERSIBLE * common name: ** 3-(4-Hydroxyphenyl)pyruvate keto...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=34HPPYRI 34HPPYRI] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** ( | + | ** 3-(4-Hydroxyphenyl)pyruvate keto-enol-isomerase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | == | + | ** 1.0 [[P-HYDROXY-PHENYLPYRUVATE]][c] '''<=>''' 1.0 [[P-HYDROXY-PHENYLPYRUVATE]][c] |
| − | * [[ | + | * With common name(s): |
| + | ** 1.0 4-hydroxyphenylpyruvate[c] '''<=>''' 1.0 4-hydroxyphenylpyruvate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_5011]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=3-(4-Hydroxyphenyl)pyruvate keto-enol-isomerase}} | |
| − | + | {{#set: gene associated=Tiso_gene_5011}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:21, 21 March 2018
Contents
Reaction 34HPPYRI
- direction:
- REVERSIBLE
- common name:
- 3-(4-Hydroxyphenyl)pyruvate keto-enol-isomerase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 P-HYDROXY-PHENYLPYRUVATE[c] <=> 1.0 P-HYDROXY-PHENYLPYRUVATE[c]
- With common name(s):
- 1.0 4-hydroxyphenylpyruvate[c] <=> 1.0 4-hydroxyphenylpyruvate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_5011
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
