Difference between revisions of "CPD-204"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2109 == * left end position: ** 27990 * transcription direction: ** NEGATIVE * right end position: ** 30232 * centisome position: ** 92.584...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O))) |
| − | * | + | * common name: |
| − | ** | + | ** gibberellin A8 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 363.386 |
* Synonym(s): | * Synonym(s): | ||
| + | ** GA8 | ||
| + | ** 2β-hydroxygibberellin 1 | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-115]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203521 25203521] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28861 28861] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03579 C03579] |
| + | {{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}} | ||
| + | {{#set: common name=gibberellin A8}} | ||
| + | {{#set: inchi key=InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M}} | ||
| + | {{#set: molecular weight=363.386 }} | ||
| + | {{#set: common name=GA8|2β-hydroxygibberellin 1}} | ||
| + | {{#set: produced by=RXN-115}} | ||
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite CPD-204
- smiles:
- C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
- common name:
- gibberellin A8
- inchi key:
- InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M
- molecular weight:
- 363.386
- Synonym(s):
- GA8
- 2β-hydroxygibberellin 1
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.
