Difference between revisions of "AICARTRANSFORM-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8120 CPD-8120] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)[O-] * inchi key: ** InChIKey=HOB...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AICARTRANSFORM-RXN AICARTRANSFORM-RXN] == * direction: ** REVERSIBLE * common name: ** bifunctional...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AICARTRANSFORM-RXN AICARTRANSFORM-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** bifunctional_purine_biosynthesis |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.1.2.3 EC-2.1.2.3] |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5-aminoimidazole-4-carboxamide ribonucleotide transformylase |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[FORMYL-THF-GLU-N]][c] '''+''' 1 [[AICAR]][c] '''<=>''' 1 [[PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE]][c] '''+''' 1 [[THF-GLU-N]][c] |
− | == | + | * With common name(s): |
+ | ** 1 an N10-formyl-tetrahydrofolate[c] '''+''' 1 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide[c] '''<=>''' 1 5-formamido-1-(5-phospho-D-ribosyl)-imidazole-4-carboxamide[c] '''+''' 1 a tetrahydrofolate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_18420]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6123]], inosine-5'-phosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6123 PWY-6123] | ||
+ | ** '''5''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-6124]], inosine-5'-phosphate biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6124 PWY-6124] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22192 22192] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04560 R04560] | |
− | * LIGAND- | + | * UNIPROT: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P43852 P43852] |
− | * | + | ** [http://www.uniprot.org/uniprot/P12048 P12048] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P31335 P31335] |
− | * | + | ** [http://www.uniprot.org/uniprot/P26978 P26978] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P15639 P15639] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PNY2 Q9PNY2] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9JUQ8 Q9JUQ8] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P31939 P31939] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q59493 Q59493] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P38009 P38009] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P54113 P54113] |
+ | ** [http://www.uniprot.org/uniprot/O64767 O64767] | ||
+ | ** [http://www.uniprot.org/uniprot/O74928 O74928] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=bifunctional_purine_biosynthesis}} | ||
+ | {{#set: ec number=EC-2.1.2.3}} | ||
+ | {{#set: common name=5-aminoimidazole-4-carboxamide ribonucleotide transformylase}} | ||
+ | {{#set: gene associated=Tiso_gene_18420}} | ||
+ | {{#set: in pathway=PWY-6123|PWY-6124}} | ||
+ | {{#set: reconstruction category=orthology|manual|annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|manual-primary_network|annotation-experimental_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:21, 21 March 2018
Contents
Reaction AICARTRANSFORM-RXN
- direction:
- REVERSIBLE
- common name:
- bifunctional_purine_biosynthesis
- ec number:
- Synonym(s):
- 5-aminoimidazole-4-carboxamide ribonucleotide transformylase
Reaction Formula
- With identifiers:
- 1 FORMYL-THF-GLU-N[c] + 1 AICAR[c] <=> 1 PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE[c] + 1 THF-GLU-N[c]
- With common name(s):
- 1 an N10-formyl-tetrahydrofolate[c] + 1 5-amino-1-(5-phospho-D-ribosyl)imidazole-4-carboxamide[c] <=> 1 5-formamido-1-(5-phospho-D-ribosyl)-imidazole-4-carboxamide[c] + 1 a tetrahydrofolate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18420
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- PWY-6123, inosine-5'-phosphate biosynthesis I: PWY-6123
- 5 reactions found over 6 reactions in the full pathway
- PWY-6124, inosine-5'-phosphate biosynthesis II: PWY-6124
- 5 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: