Difference between revisions of "CPD-11665"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7682 RXN-7682] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] == * smiles: ** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2)) * common name: **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7682 RXN-7682] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11665 CPD-11665] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.17.1.4 EC-1.17.1.4]
+
** serotonin O-sulfate
 +
* inchi key:
 +
** InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 256.276   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-hydroxytryptamine O-sulfate
 +
** 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
 +
** 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NAD]][c] '''+''' 1 [[HYPOXANTHINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[XANTHINE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c]
+
* [[RXN-10777]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NAD+[c] '''+''' 1 hypoxanthine[c] '''+''' 1 H2O[c] '''=>''' 1 xanthine[c] '''+''' 1 H+[c] '''+''' 1 NADH[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_11775]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
== Pathways  ==
+
−
* [[P164-PWY]], purine nucleobases degradation I (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=P164-PWY P164-PWY]
+
−
** '''4''' reactions found over '''17''' reactions in the full pathway
+
−
* [[PWY-6596]], adenosine nucleotides degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6596 PWY-6596]
+
−
** '''8''' reactions found over '''8''' reactions in the full pathway
+
−
* [[SALVADEHYPOX-PWY]], adenosine nucleotides degradation II: [http://metacyc.org/META/NEW-IMAGE?object=SALVADEHYPOX-PWY SALVADEHYPOX-PWY]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[athaliana]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24670 24670]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=152151 152151]
−
* LIGAND-RXN:
+
* CHEMSPIDER:
−
** [http://www.genome.jp/dbget-bin/www_bget?R01768 R01768]
+
** [http://www.chemspider.com/Chemical-Structure.134104.html 134104]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))}}
−
{{#set: ec number=EC-1.17.1.4}}
+
{{#set: common name=serotonin O-sulfate}}
−
{{#set: gene associated=Tiso_gene_11775}}
+
{{#set: inchi key=InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N}}
−
{{#set: in pathway=P164-PWY|PWY-6596|SALVADEHYPOX-PWY}}
+
{{#set: molecular weight=256.276    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=5-hydroxytryptamine O-sulfate|3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate|1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN-10777}}
−
{{#set: reconstruction source=athaliana}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Latest revision as of 21:21, 21 March 2018

Metabolite CPD-11665

  • smiles:
    • C(N)CC1(=CNC2(=C1C=C(OS(=O)(=O)O)C=C2))
  • common name:
    • serotonin O-sulfate
  • inchi key:
    • InChIKey=JFWYSGGSCOOBGK-UHFFFAOYSA-N
  • molecular weight:
    • 256.276
  • Synonym(s):
    • 5-hydroxytryptamine O-sulfate
    • 3-(2-aminoethyl)-1H-indol-5-yl hydrogen sulfate
    • 1H-indol-5-ol, 3-(2-aminoethyl)-, hydrogen sulfate (ester)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11665&oldid=48125"