Difference between revisions of "CPD-19172"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.8.4.9-RXN 1.8.4.9-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] == * smiles: ** CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.8.4.9-RXN 1.8.4.9-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19172 CPD-19172] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.8.4.9 EC-1.8.4.9]
+
** (2E,9Z)-octadecenoyl-CoA
 +
* inchi key:
 +
** InChIKey=REOYMONHGHULEY-PPSVNWDXSA-J
 +
* molecular weight:
 +
** 1025.937   
 
* Synonym(s):
 
* Synonym(s):
 +
** 18:2-Δ2,Δ9-CoA
 +
** 2-trans,9-cis-octadecenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 2 [[GLUTATHIONE]][c] '''+''' 1 [[APS]][c] '''=>''' 2 [[PROTON]][c] '''+''' 1 [[OXIDIZED-GLUTATHIONE]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[SO3]][c]
+
* [[RXN-17775]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 glutathione[c] '''+''' 1 adenosine 5'-phosphosulfate[c] '''=>''' 2 H+[c] '''+''' 1 glutathione disulfide[c] '''+''' 1 AMP[c] '''+''' 1 sulfite[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[SULFMETII-PWY]], sulfate reduction II (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=SULFMETII-PWY SULFMETII-PWY]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[manual]]:
+
−
** [[primary_network]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
{{#set: smiles=CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14141 14141]
+
{{#set: common name=(2E,9Z)-octadecenoyl-CoA}}
−
* LIGAND-RXN:
+
{{#set: inchi key=InChIKey=REOYMONHGHULEY-PPSVNWDXSA-J}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R05717 R05717]
+
{{#set: molecular weight=1025.937    }}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=18:2-Δ2,Δ9-CoA|2-trans,9-cis-octadecenoyl-CoA}}
−
{{#set: ec number=EC-1.8.4.9}}
+
{{#set: produced by=RXN-17775}}
−
{{#set: in pathway=SULFMETII-PWY}}
+
−
{{#set: reconstruction category=manual}}
+
−
{{#set: reconstruction source=primary_network}}
+

Latest revision as of 21:21, 21 March 2018

Metabolite CPD-19172

  • smiles:
    • CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • (2E,9Z)-octadecenoyl-CoA
  • inchi key:
    • InChIKey=REOYMONHGHULEY-PPSVNWDXSA-J
  • molecular weight:
    • 1025.937
  • Synonym(s):
    • 18:2-Δ2,Δ9-CoA
    • 2-trans,9-cis-octadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-19172&oldid=48128"