Difference between revisions of "Aldoses"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aldoses Aldoses] == * common name: ** an aldose * Synonym(s): ** an aldose == Reaction(s) know...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-204 CPD-204] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aldoses Aldoses] ==
* smiles:
+
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
* inchi key:
+
** InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M
+
 
* common name:
 
* common name:
** gibberellin A8
+
** an aldose
* molecular weight:
+
** 363.386   
+
 
* Synonym(s):
 
* Synonym(s):
** GA8
+
** an aldose
** 2β-hydroxygibberellin 1
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-115]]
+
* [[RXN-9926]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[ALDEHYDE-REDUCTASE-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an aldose}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203521 25203521]
+
{{#set: common name=an aldose}}
* CHEBI:
+
{{#set: produced by=RXN-9926}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28861 28861]
+
{{#set: reversible reaction associated=ALDEHYDE-REDUCTASE-RXN}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03579 C03579]
+
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=WZRRJZYYGOOHRC-AXLMTQBOSA-M}}
+
{{#set: common name=gibberellin A8}}
+
{{#set: molecular weight=363.386    }}
+
{{#set: common name=GA8|2β-hydroxygibberellin 1}}
+
{{#set: produced by=RXN-115}}
+

Latest revision as of 21:22, 21 March 2018

Metabolite Aldoses

  • common name:
    • an aldose
  • Synonym(s):
    • an aldose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links