Difference between revisions of "CPD-17284"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15834 CPD-15834] == * smiles: ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17284 CPD-17284] == * common name: ** a [glycerolipid]-arachidonate * Synonym(s): ** a [gly...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15834 CPD-15834] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17284 CPD-17284] ==
−
* smiles:
+
−
** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C
+
−
* inchi key:
+
−
** InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N
+
 
* common name:
 
* common name:
−
** 2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol
+
** a [glycerolipid]-arachidonate
−
* molecular weight:
+
−
** 410.639   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetraenoate
 +
** a [glycerolipid]-arachidonic acid
 +
** a [glycerolipid]-all-cis-icosa-5,8,11,14-tetraenoate
 +
** a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetra-5,8,11,14-enoate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-14917]]
+
* [[RXN-8346]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=a [glycerolipid]-arachidonate}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C20738 C20738]
+
{{#set: common name=a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetraenoate|a [glycerolipid]-arachidonic acid|a [glycerolipid]-all-cis-icosa-5,8,11,14-tetraenoate|a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetra-5,8,11,14-enoate}}
−
* CHEBI:
+
{{#set: produced by=RXN-8346}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75412 75412]
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5327035 5327035]
+
−
{{#set: smiles=CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=C(C)C(O)=C1))C)C}}
+
−
{{#set: inchi key=InChIKey=QFMVWSPTQOCGTB-TUZVQDLTSA-N}}
+
−
{{#set: common name=2,3-dimethyl-6-geranylgeranyl-1,4-benzoquinol}}
+
−
{{#set: molecular weight=410.639    }}
+
−
{{#set: produced by=RXN-14917}}
+

Latest revision as of 21:22, 21 March 2018

Metabolite CPD-17284

  • common name:
    • a [glycerolipid]-arachidonate
  • Synonym(s):
    • a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetraenoate
    • a [glycerolipid]-arachidonic acid
    • a [glycerolipid]-all-cis-icosa-5,8,11,14-tetraenoate
    • a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetra-5,8,11,14-enoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [glycerolipid]-arachidonate" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetraenoate" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-arachidonic acid" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-all-cis-icosa-5,8,11,14-tetraenoate" cannot be used as a page name in this wiki.
  • "a [glycerolipid]-(5Z,8Z,11Z,14Z)-icosatetra-5,8,11,14-enoate" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-17284&oldid=48144"