Difference between revisions of "RXN0-2921"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-L-MYO-INOSITOL-1-P 1-L-MYO-INOSITOL-1-P] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2921 RXN0-2921] == * direction: ** LEFT-TO-RIGHT * common name: ** folylpolyglutamate_synthase...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-L-MYO-INOSITOL-1-P 1-L-MYO-INOSITOL-1-P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2921 RXN0-2921] ==
−
* smiles:
+
* direction:
−
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=INAPMGSXUVUWAF-PTQMNWPWSA-L
+
 
* common name:
 
* common name:
−
** 1D-myo-inositol 3-monophosphate
+
** folylpolyglutamate_synthase
−
* molecular weight:
+
** bifunctional_protein
−
** 258.121   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/6.3.2.17 EC-6.3.2.17]
 
* Synonym(s):
 
* Synonym(s):
−
** 1-L-myo-inositol-1-p
 
−
** L-myo-inositol 1-phosphate
 
−
** inositol 1-phosphate
 
−
** myo-inositol 1-phosphate
 
−
** 1D-myo-inositol 3-phosphate
 
−
** Ins(3)P1
 
−
** D-myo-inositol (3)-monophosphate
 
−
** myo-inositol 1-monophosphate
 
−
** Ins3P
 
−
** 1L-myo-inositol 1-phosphate
 
−
** myo-inositol phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[ATP]][c] '''+''' 1 [[METHYLENE-THF-GLU-N]][c] '''+''' 1 [[GLT]][c] '''=>''' 1 [[METHYLENE-THF-GLU-N]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[ADP]][c]
−
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
+
* With common name(s):
−
* [[RXN66-579]]
+
** 1 ATP[c] '''+''' 1 a 5,10-methylene-tetrahydrofolate[c] '''+''' 1 L-glutamate[c] '''=>''' 1 a 5,10-methylene-tetrahydrofolate[c] '''+''' 1 phosphate[c] '''+''' 1 ADP[c]
−
* [[RXN-10960]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_92]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_15942]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-2161]], folate polyglutamylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2161 PWY-2161]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288700 5288700]
+
{{#set: common name=folylpolyglutamate_synthase}}
−
* HMDB : HMDB06814
+
{{#set: common name=bifunctional_protein}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-6.3.2.17}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04006 C04006]
+
{{#set: gene associated=Tiso_gene_92|Tiso_gene_15942}}
−
* CHEMSPIDER:
+
{{#set: in pathway=PWY-2161}}
−
** [http://www.chemspider.com/Chemical-Structure.16744087.html 16744087]
+
{{#set: reconstruction category=orthology|annotation}}
−
* CHEBI:
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58401 58401]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
* METABOLIGHTS : MTBLC58401
+
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-PTQMNWPWSA-L}}
+
−
{{#set: common name=1D-myo-inositol 3-monophosphate}}
+
−
{{#set: molecular weight=258.121    }}
+
−
{{#set: common name=1-L-myo-inositol-1-p|L-myo-inositol 1-phosphate|inositol 1-phosphate|myo-inositol 1-phosphate|1D-myo-inositol 3-phosphate|Ins(3)P1|D-myo-inositol (3)-monophosphate|myo-inositol 1-monophosphate|Ins3P|1L-myo-inositol 1-phosphate|myo-inositol phosphate}}
+
−
{{#set: consumed by=MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN}}
+
−
{{#set: produced by=MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN|RXN66-579|RXN-10960}}
+

Latest revision as of 20:22, 21 March 2018

Reaction RXN0-2921

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • folylpolyglutamate_synthase
    • bifunctional_protein
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 a 5,10-methylene-tetrahydrofolate[c] + 1 L-glutamate[c] => 1 a 5,10-methylene-tetrahydrofolate[c] + 1 phosphate[c] + 1 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-2161, folate polyglutamylation: PWY-2161
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN0-2921&oldid=48170"