Difference between revisions of "CPD-8122"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=orDC orDC] == * direction: ** LEFT-TO-RIGHT * common name: ** ornithine decarboxylase * Synonym(s):...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=orDC orDC] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]
 
* common name:
 
* common name:
−
** ornithine decarboxylase
+
** molybdopterin adenine dinucleotide
 +
* inchi key:
 +
** InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
 +
* molecular weight:
 +
** 721.529   
 
* Synonym(s):
 
* Synonym(s):
 +
** adenylated molybdopterin
 +
** H2Dtpp-mADP
 +
** molybdopterin-AMP
 +
** adenylyl-molybdopterin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-8348]]
−
** 1.0 [[L-ORNITHINE]][c] '''+''' 1.0 [[PROTON]][c] '''=>''' 1.0 [[CARBON-DIOXIDE]][c] '''+''' 1.0 [[PUTRESCINE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 L-ornithine[c] '''+''' 1.0 H+[c] '''=>''' 1.0 CO2[c] '''+''' 1.0 putrescine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10737]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ornithine decarboxylase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356704 53356704]
−
{{#set: gene associated=Tiso_gene_10737}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62727 62727]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=molybdopterin adenine dinucleotide}}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: inchi key=InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K}}
 +
{{#set: molecular weight=721.529    }}
 +
{{#set: common name=adenylated molybdopterin|H2Dtpp-mADP|molybdopterin-AMP|adenylyl-molybdopterin}}
 +
{{#set: consumed by=RXN-8348}}

Latest revision as of 20:22, 21 March 2018

Metabolite CPD-8122

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]
  • common name:
    • molybdopterin adenine dinucleotide
  • inchi key:
    • InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
  • molecular weight:
    • 721.529
  • Synonym(s):
    • adenylated molybdopterin
    • H2Dtpp-mADP
    • molybdopterin-AMP
    • adenylyl-molybdopterin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-8122&oldid=48233"