Difference between revisions of "Tiso gene 3974"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3))) * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_3974 == * right end position: ** 7701 * transcription direction: ** POSITIVE * left end position: ** 5259 * centisome position: ** 20.22614...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3974 == |
− | * | + | * right end position: |
− | ** | + | ** 7701 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 5259 |
− | * | + | * centisome position: |
− | ** | + | ** 20.226145 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3-DEHYDROQUINATE-SYNTHASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | * [[RXN- | + | ** Source: [[orthology-athaliana]] |
− | == | + | ** Source: [[orthology-synechocystis]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[SHIKIMATE-KINASE-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6164]] | ||
+ | * [[PWY-6163]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=7701}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=5259}} | |
− | + | {{#set: centisome position=20.226145 }} | |
− | + | {{#set: reaction associated=3-DEHYDROQUINATE-SYNTHASE-RXN|SHIKIMATE-KINASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-6164|PWY-6163}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:22, 21 March 2018
Gene Tiso_gene_3974
- right end position:
- 7701
- transcription direction:
- POSITIVE
- left end position:
- 5259
- centisome position:
- 20.226145
- Synonym(s):
Reactions associated
- Reaction: 3-DEHYDROQUINATE-SYNTHASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Reaction: SHIKIMATE-KINASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation