Difference between revisions of "CPD-12365"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4953 == * Synonym(s): == Reactions associated == * MALTODEXGLUCOSID-RXN ** pantograph-esiliculosus * RXN-14281 ** pantog...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == |
| + | * smiles: | ||
| + | ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23))) | ||
| + | * common name: | ||
| + | ** 8-oxo-dGMP | ||
| + | * inchi key: | ||
| + | ** InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L | ||
| + | * molecular weight: | ||
| + | ** 361.207 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 8-oxo-7,8-dihydro-2'-dGMP | ||
| + | ** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate | ||
| + | ** 8-oxo-deoxyguanosine-monophosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-14205]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173535 46173535] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63224 63224] | ||
| + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}} | ||
| + | {{#set: common name=8-oxo-dGMP}} | ||
| + | {{#set: inchi key=InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L}} | ||
| + | {{#set: molecular weight=361.207 }} | ||
| + | {{#set: common name=8-oxo-7,8-dihydro-2'-dGMP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate|8-oxo-deoxyguanosine-monophosphate}} | ||
| + | {{#set: reversible reaction associated=RXN-14205}} | ||
Latest revision as of 20:22, 21 March 2018
Contents
Metabolite CPD-12365
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
- common name:
- 8-oxo-dGMP
- inchi key:
- InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L
- molecular weight:
- 361.207
- Synonym(s):
- 8-oxo-7,8-dihydro-2'-dGMP
- 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate
- 8-oxo-deoxyguanosine-monophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.
