Difference between revisions of "ATCY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13754 CPD-13754] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(=O)CCC2(C)(C(=O)CC[...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATCY ATCY] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:cytidine 5'-phosphotransferase *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13754 CPD-13754] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATCY ATCY] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(=O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=IWNWMTZIJPUDPV-MDQHZGBLSA-J
+
 
* common name:
 
* common name:
−
** 3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA
+
** ATP:cytidine 5'-phosphotransferase
−
* molecular weight:
+
−
** 983.77   
+
 
* Synonym(s):
 
* Synonym(s):
−
** HIP-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12747]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ATP]][c] '''+''' 1.0 [[CYTIDINE]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[ADP]][c] '''+''' 1.0 [[CMP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 ATP[c] '''+''' 1.0 cytidine[c] '''=>''' 1.0 H+[c] '''+''' 1.0 ADP[c] '''+''' 1.0 CMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14474]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_20134]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289539 86289539]
+
{{#set: common name=ATP:cytidine 5'-phosphotransferase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_14474|Tiso_gene_20134}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78357 78357]
+
{{#set: in pathway=}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(=O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=IWNWMTZIJPUDPV-MDQHZGBLSA-J}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=983.77    }}
+
−
{{#set: common name=HIP-CoA}}
+
−
{{#set: consumed by=RXN-12747}}
+

Latest revision as of 20:22, 21 March 2018

Reaction ATCY

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ATP:cytidine 5'-phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 ATP[c] + 1.0 cytidine[c] => 1.0 H+[c] + 1.0 ADP[c] + 1.0 CMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ATCY&oldid=48268"