Difference between revisions of "Tiso gene 13079"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETALDEHYDE INDOLE_ACETALDEHYDE] == * smiles: ** C(CC1(C2(=C(NC=1)C=CC=C2)))=O * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_13079 == * right end position: ** 6032 * transcription direction: ** POSITIVE * left end position: ** 3091 * centisome position: ** 47.2052...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13079 == |
− | * | + | * right end position: |
− | ** | + | ** 6032 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3091 |
− | * | + | * centisome position: |
− | ** | + | ** 47.205254 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[RXN-13374]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | == | + | == Pathways associated == |
+ | * [[PWY-6857]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=6032}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3091}} | |
− | + | {{#set: centisome position=47.205254 }} | |
− | + | {{#set: reaction associated=RXN-13374}} | |
− | + | {{#set: pathway associated=PWY-6857}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:05, 21 March 2018
Gene Tiso_gene_13079
- right end position:
- 6032
- transcription direction:
- POSITIVE
- left end position:
- 3091
- centisome position:
- 47.205254
- Synonym(s):
Reactions associated
- Reaction: RXN-13374
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation