Difference between revisions of "RXN-11476"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11476 RXN-11476] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-glutaryl-[acp] methyl...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11476 RXN-11476] ==
−
* smiles:
+
* direction:
−
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
+
 
* common name:
 
* common name:
−
** molybdopterin adenine dinucleotide
+
** 3-oxo-glutaryl-[acp] methyl ester reductase
−
* molecular weight:
+
** 3-oxoacyl-(acyl-carrier-protein)
−
** 721.529   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
 
* Synonym(s):
 
* Synonym(s):
−
** adenylated molybdopterin
 
−
** H2Dtpp-mADP
 
−
** molybdopterin-AMP
 
−
** adenylyl-molybdopterin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8348]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[3-Ketoglutaryl-ACP-methyl-ester]][c] '''=>''' 1 [[3-Hydroxyglutaryl-ACP-methyl-ester]][c] '''+''' 1 [[NADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 a 3-oxo-glutaryl-[acp] methyl ester[c] '''=>''' 1 a (3R)-3-hydroxyglutaryl-[acp] methyl ester[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13083]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_9885]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
 +
** '''9''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356704 53356704]
+
{{#set: common name=3-oxo-glutaryl-[acp] methyl ester reductase}}
−
* CHEBI:
+
{{#set: common name=3-oxoacyl-(acyl-carrier-protein)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62727 62727]
+
{{#set: ec number=EC-1.1.1.100}}
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]}}
+
{{#set: gene associated=Tiso_gene_13083|Tiso_gene_9885}}
−
{{#set: inchi key=InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K}}
+
{{#set: in pathway=PWY-6519}}
−
{{#set: common name=molybdopterin adenine dinucleotide}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: molecular weight=721.529    }}
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}}
−
{{#set: common name=adenylated molybdopterin|H2Dtpp-mADP|molybdopterin-AMP|adenylyl-molybdopterin}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: consumed by=RXN-8348}}
+

Latest revision as of 20:22, 21 March 2018

Reaction RXN-11476

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxo-glutaryl-[acp] methyl ester reductase
    • 3-oxoacyl-(acyl-carrier-protein)
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6519, 8-amino-7-oxononanoate biosynthesis I: PWY-6519
    • 9 reactions found over 11 reactions in the full pathway

Reconstruction information

External links

"3-oxo-glutaryl-[acp] methyl ester reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-11476&oldid=48274"