Difference between revisions of "Tiso gene 15467"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi ke...") |
(Created page with "Category:Gene == Gene Tiso_gene_15467 == * Synonym(s): == Reactions associated == * Reaction: RXN-15556 ** Source: orthology-esiliculosus == Pathways associated =...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15467 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-15556]] | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | == Pathways associated == |
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-15556}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 21:23, 21 March 2018
Gene Tiso_gene_15467
- Synonym(s):
Reactions associated
- Reaction: RXN-15556
- Source: orthology-esiliculosus