Difference between revisions of "CPDQT-40"

Latest revision as of 20:23, 21 March 2018

"CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-glutaminyl-Protein L-methionyl-L-glutaminyl-Protein] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] ==
+* smiles:
+** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
 * common name:
-** an N-terminal-L-methionyl-L-glutaminyl-[protein]
+** 3-(7'-methylthio)heptylmalate
+* inchi key:
+** InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L
+* molecular weight:
+** 276.347
 * Synonym(s):
+** 3-(7'-methylthio)heptylmalic acid
 == Reaction(s) known to consume the compound ==
-* [[RXN-17851]]
+* [[RXNQT-4178]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
+* [[RXN-18200]]
 == External links  ==
-{{#set: common name=an N-terminal-L-methionyl-L-glutaminyl-[protein]}}
+* PUBCHEM:
-{{#set: consumed by=RXN-17851}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237172 44237172]
+{{#set: smiles=CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
+{{#set: common name=3-(7'-methylthio)heptylmalate}}
+{{#set: inchi key=InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L}}
+{{#set: molecular weight=276.347    }}
+{{#set: common name=3-(7'-methylthio)heptylmalic acid}}
+{{#set: consumed by=RXNQT-4178}}
+{{#set: reversible reaction associated=RXN-18200}}