Difference between revisions of "ANDROST4ENE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UROPORIIIMETHYLTRANSA-RXN UROPORIIIMETHYLTRANSA-RXN] == * direction: ** LEFT-TO-RIGHT * Synonym(s):...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANDROST4ENE ANDROST4ENE] == * smiles: ** CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3)...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANDROST4ENE ANDROST4ENE] == |
− | * | + | * smiles: |
− | ** | + | ** CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3))4) |
+ | * common name: | ||
+ | ** androst-4-ene-3,17-dione | ||
+ | * inchi key: | ||
+ | ** InChIKey=AEMFNILZOJDQLW-QAGGRKNESA-N | ||
+ | * molecular weight: | ||
+ | ** 286.413 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4-androstene-3,17-dione |
− | + | ** androstenedione | |
− | + | ||
− | + | ||
− | ** | + | |
− | + | ||
− | + | ||
− | + | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-12124]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * LIPID_MAPS : LMST02020007 |
− | ** [http:// | + | * PUBCHEM: |
− | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6128 6128] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * CAS : 63-05-8 |
− | + | * DRUGBANK : DB01536 | |
− | {{#set: | + | * NCI: |
− | {{#set: | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=9563 9563] |
− | {{#set: | + | * HMDB : HMDB00053 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00280 C00280] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16422 16422] | ||
+ | * METABOLIGHTS : MTBLC16422 | ||
+ | {{#set: smiles=CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3))4)}} | ||
+ | {{#set: common name=androst-4-ene-3,17-dione}} | ||
+ | {{#set: inchi key=InChIKey=AEMFNILZOJDQLW-QAGGRKNESA-N}} | ||
+ | {{#set: molecular weight=286.413 }} | ||
+ | {{#set: common name=4-androstene-3,17-dione|androstenedione}} | ||
+ | {{#set: produced by=RXN-12124}} |
Latest revision as of 20:21, 21 March 2018
Contents
Metabolite ANDROST4ENE
- smiles:
- CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3))4)
- common name:
- androst-4-ene-3,17-dione
- inchi key:
- InChIKey=AEMFNILZOJDQLW-QAGGRKNESA-N
- molecular weight:
- 286.413
- Synonym(s):
- 4-androstene-3,17-dione
- androstenedione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMST02020007
- PUBCHEM:
- CAS : 63-05-8
- DRUGBANK : DB01536
- NCI:
- HMDB : HMDB00053
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC16422
"CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3))4)" cannot be used as a page name in this wiki.