Difference between revisions of "HIS"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETAINE BETAINE] == * smiles: ** C[N+](C)(CC([O-])=O)C * inchi key: ** InChIKey=KWIUHFFTVRNATP-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * smiles: ** C1(NC=NC=1CC(C(=O)[O-])[N+]) * common name: ** L-histidine * inchi key...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == |
* smiles: | * smiles: | ||
| − | ** C | + | ** C1(NC=NC=1CC(C(=O)[O-])[N+]) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-histidine |
| + | * inchi key: | ||
| + | ** InChIKey=HNDVDQJCIGZPNO-YFKPBYRVSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 155.156 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** glyoxaline-5-alanine |
| − | ** | + | ** α-amino-4-imidazoleproprionic acid |
| − | ** | + | ** (S)-α-amino-1H-imidazole-4-propanoic acid |
| − | ** | + | ** H |
| − | ** | + | ** histidine |
| − | ** | + | ** his |
| + | ** L-his | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RME144]] | ||
| + | * [[HISTIDINE--TRNA-LIGASE-RXN]] | ||
| + | * [[CARNOSINE-SYNTHASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8001]] |
| + | * [[HISTALDEHYD-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 71-00-1 |
| − | * | + | * BIGG : his__L |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971009 6971009] |
| − | * HMDB : | + | * HMDB : HMDB00177 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00135 C00135] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57595 57595] |
| − | * | + | * METABOLIGHTS : MTBLC57595 |
| − | {{#set: smiles=C | + | {{#set: smiles=C1(NC=NC=1CC(C(=O)[O-])[N+])}} |
| − | {{#set: | + | {{#set: common name=L-histidine}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=HNDVDQJCIGZPNO-YFKPBYRVSA-N}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=155.156 }} |
| − | {{#set: common name= | + | {{#set: common name=glyoxaline-5-alanine|α-amino-4-imidazoleproprionic acid|(S)-α-amino-1H-imidazole-4-propanoic acid|H|histidine|his|L-his}} |
| − | {{#set: | + | {{#set: consumed by=RME144|HISTIDINE--TRNA-LIGASE-RXN|CARNOSINE-SYNTHASE-RXN}} |
| − | {{#set: | + | {{#set: produced by=RXN-8001|HISTALDEHYD-RXN}} |
Latest revision as of 20:23, 21 March 2018
Contents
Metabolite HIS
- smiles:
- C1(NC=NC=1CC(C(=O)[O-])[N+])
- common name:
- L-histidine
- inchi key:
- InChIKey=HNDVDQJCIGZPNO-YFKPBYRVSA-N
- molecular weight:
- 155.156
- Synonym(s):
- glyoxaline-5-alanine
- α-amino-4-imidazoleproprionic acid
- (S)-α-amino-1H-imidazole-4-propanoic acid
- H
- histidine
- his
- L-his
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 71-00-1
- BIGG : his__L
- PUBCHEM:
- HMDB : HMDB00177
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57595
"C1(NC=NC=1CC(C(=O)[O-])[N+])" cannot be used as a page name in this wiki.
