Difference between revisions of "Poly-Gamma-Glutamylcysteine-Glycines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] == * smiles: ** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-Gamma-Glutamylcysteine-Glycines Poly-Gamma-Glutamylcysteine-Glycines] == * common name: **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-LACTOYL-GLUTATHIONE S-LACTOYL-GLUTATHIONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-Gamma-Glutamylcysteine-Glycines Poly-Gamma-Glutamylcysteine-Glycines] ==
* smiles:
+
** CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
+
* inchi key:
+
** InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M
+
 
* common name:
 
* common name:
** (R)-S-lactoylglutathione
+
** a poly-[γ-glutamylcysteine]-glycine
* molecular weight:
+
** 378.376   
+
 
* Synonym(s):
 
* Synonym(s):
** S-D-lactoylglutathione
+
** a phytochelatin
** D-lactoylglutathione
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLYOXII-RXN]]
+
* [[2.3.2.15-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.3.2.15-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[GLYOXI-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 25138-66-3
+
{{#set: common name=a poly-[γ-glutamylcysteine]-glycine}}
* PUBCHEM:
+
{{#set: common name=a phytochelatin}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878377 46878377]
+
{{#set: consumed by=2.3.2.15-RXN}}
* HMDB : HMDB01066
+
{{#set: produced by=2.3.2.15-RXN}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03451 C03451]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57474 57474]
+
* BIGG : lgt__S
+
{{#set: smiles=CC(O)C(=O)SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
+
{{#set: inchi key=InChIKey=VDYDCVUWILIYQF-CSMHCCOUSA-M}}
+
{{#set: common name=(R)-S-lactoylglutathione}}
+
{{#set: molecular weight=378.376    }}
+
{{#set: common name=S-D-lactoylglutathione|D-lactoylglutathione}}
+
{{#set: consumed by=GLYOXII-RXN}}
+
{{#set: consumed or produced by=GLYOXI-RXN}}
+

Latest revision as of 20:23, 21 March 2018

Metabolite Poly-Gamma-Glutamylcysteine-Glycines

  • common name:
    • a poly-[γ-glutamylcysteine]-glycine
  • Synonym(s):
    • a phytochelatin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a poly-[γ-glutamylcysteine]-glycine" cannot be used as a page name in this wiki.