Difference between revisions of "RXN-775"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * smiles: ** C1(NC=NC=1CC(C(=O)[O-])[N+]) * inchi key: ** InChIKey=HNDVDQJCIGZPNO-Y...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-775 RXN-775] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.1...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-775 RXN-775] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/1.1 EC-1.1] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[Acceptor]][c] '''+''' 1 [[CPD-715]][c] '''=>''' 1 [[CPD-717]][c] '''+''' 1 [[Donor-H2]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 an oxidized electron acceptor[c] '''+''' 1 6-deoxoteasterone[c] '''=>''' 1 3-dehydro-6-deoxoteasterone[c] '''+''' 1 a reduced electron acceptor[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | == | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[Tiso_gene_3577]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_8263]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-2582]], brassinosteroid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2582 PWY-2582] | ||
+ | ** '''7''' reactions found over '''21''' reactions in the full pathway | ||
+ | * [[PWY-699]], brassinosteroid biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-699 PWY-699] | ||
+ | ** '''11''' reactions found over '''25''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07449 R07449] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-1.1}} | |
− | + | {{#set: gene associated=Tiso_gene_3577|Tiso_gene_8263}} | |
− | * LIGAND- | + | {{#set: in pathway=PWY-2582|PWY-699}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction category=orthology}} |
− | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:23, 21 March 2018
Contents
Reaction RXN-775
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 an oxidized electron acceptor[c] + 1 6-deoxoteasterone[c] => 1 3-dehydro-6-deoxoteasterone[c] + 1 a reduced electron acceptor[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3577
- Source: orthology-esiliculosus
- Gene: Tiso_gene_8263
- Source: orthology-esiliculosus
Pathways
- PWY-2582, brassinosteroid biosynthesis II: PWY-2582
- 7 reactions found over 21 reactions in the full pathway
- PWY-699, brassinosteroid biosynthesis I: PWY-699
- 11 reactions found over 25 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
- LIGAND-RXN: